Compound Q&A

What precautions should be taken when handling 4(1H)-Quinazolinone, 2-amino-6-methyl-5-(4-pyridinylthio) (CAS: 147149-76-6)?

Answer

4(1H)-Quinazolinone, 2-amino-6-methyl-5-(4-pyridinylthio)-
When handling 4(1H)-Quinazolinone, 2-amino-6-methyl-5-(4-pyridinylthio), appropriate personal protective equipment (PPE) such as gloves, goggles, and lab coats should be worn. The compound should be handled in a well-ventilated area or a fume hood to minimize exposure. Spills should be cleaned up using appropriate absorbent materials, and the area should be well-ventilated. Detailed safety data sheets (SDS) should be consulted for specific handling procedures and emergency response information.

About

English Name 4(1H)-Quinazolinone, 2-amino-6-methyl-5-(4-pyridinylthio)-
Molecular Formula C14H12N4OS
Molecular Weight 284.34 g/mol
SMILES CC1=C(C2=C(C=C1)N=C(NC2=O)N)SC3=CC=NC=C3
InChIKey XHWRWCSCBDLOLM-UHFFFAOYSA-N
Last Updated: 2026-03-10 19:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4(1H)-Quinazolinone, 2-amino-6-methyl-5-(4-pyridinylthio) (CAS: 147149-76-6)?

4(1H)-Quinazolinone, 2-amino-6-methyl-5-(4-pyridinylthio) is a crystalline solid with a molecular we...

Compound Q&A

How is 4(1H)-Quinazolinone, 2-amino-6-methyl-5-(4-pyridinylthio) (CAS: 147149-76-6) typically synthesized?

4(1H)-Quinazolinone, 2-amino-6-methyl-5-(4-pyridinylthio) can be synthesized using a multi-step proc...

Compound Q&A

What industries use 4(1H)-Quinazolinone, 2-amino-6-methyl-5-(4-pyridinylthio) (CAS: 147149-76-6)?

4(1H)-Quinazolinone, 2-amino-6-methyl-5-(4-pyridinylthio) finds applications in the pharmaceutical i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...