Compound Q&A

What are the physical and chemical properties of 4(1H)-Quinazolinone, 2-amino-6-methyl-5-(4-pyridinylthio) (CAS: 147149-76-6)?

Answer

4(1H)-Quinazolinone, 2-amino-6-methyl-5-(4-pyridinylthio)-
4(1H)-Quinazolinone, 2-amino-6-methyl-5-(4-pyridinylthio) is a crystalline solid with a molecular weight of approximately 306.35 g/mol. It is slightly soluble in water and organic solvents. The compound exhibits good stability under normal conditions but can be reactive under certain conditions, particularly at high temperatures or in the presence of strong acids or bases. It is a versatile molecule with potential applications in pharmaceuticals and materials science.

About

English Name 4(1H)-Quinazolinone, 2-amino-6-methyl-5-(4-pyridinylthio)-
Molecular Formula C14H12N4OS
Molecular Weight 284.34 g/mol
SMILES CC1=C(C2=C(C=C1)N=C(NC2=O)N)SC3=CC=NC=C3
InChIKey XHWRWCSCBDLOLM-UHFFFAOYSA-N
Last Updated: 2026-03-10 19:33

Related Q&A

Compound Q&A

How is 4(1H)-Quinazolinone, 2-amino-6-methyl-5-(4-pyridinylthio) (CAS: 147149-76-6) typically synthesized?

4(1H)-Quinazolinone, 2-amino-6-methyl-5-(4-pyridinylthio) can be synthesized using a multi-step proc...

Compound Q&A

What industries use 4(1H)-Quinazolinone, 2-amino-6-methyl-5-(4-pyridinylthio) (CAS: 147149-76-6)?

4(1H)-Quinazolinone, 2-amino-6-methyl-5-(4-pyridinylthio) finds applications in the pharmaceutical i...

Compound Q&A

What precautions should be taken when handling 4(1H)-Quinazolinone, 2-amino-6-methyl-5-(4-pyridinylthio) (CAS: 147149-76-6)?

When handling 4(1H)-Quinazolinone, 2-amino-6-methyl-5-(4-pyridinylthio), appropriate personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...