Compound Q&A

What industries use 4(1H)-Quinazolinone, 2-amino-6-methyl-5-(4-pyridinylthio) (CAS: 147149-76-6)?

Answer

4(1H)-Quinazolinone, 2-amino-6-methyl-5-(4-pyridinylthio)-
4(1H)-Quinazolinone, 2-amino-6-methyl-5-(4-pyridinylthio) finds applications in the pharmaceutical industry for its potential as a drug candidate. It may also be used in the development of novel materials, particularly in sensors and semiconductors, due to its unique physicochemical properties. Additionally, it can be explored for its potential in polymer synthesis and related applications.

About

English Name 4(1H)-Quinazolinone, 2-amino-6-methyl-5-(4-pyridinylthio)-
Molecular Formula C14H12N4OS
Molecular Weight 284.34 g/mol
SMILES CC1=C(C2=C(C=C1)N=C(NC2=O)N)SC3=CC=NC=C3
InChIKey XHWRWCSCBDLOLM-UHFFFAOYSA-N
Last Updated: 2026-03-10 19:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4(1H)-Quinazolinone, 2-amino-6-methyl-5-(4-pyridinylthio) (CAS: 147149-76-6)?

4(1H)-Quinazolinone, 2-amino-6-methyl-5-(4-pyridinylthio) is a crystalline solid with a molecular we...

Compound Q&A

How is 4(1H)-Quinazolinone, 2-amino-6-methyl-5-(4-pyridinylthio) (CAS: 147149-76-6) typically synthesized?

4(1H)-Quinazolinone, 2-amino-6-methyl-5-(4-pyridinylthio) can be synthesized using a multi-step proc...

Compound Q&A

What precautions should be taken when handling 4(1H)-Quinazolinone, 2-amino-6-methyl-5-(4-pyridinylthio) (CAS: 147149-76-6)?

When handling 4(1H)-Quinazolinone, 2-amino-6-methyl-5-(4-pyridinylthio), appropriate personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...