Compound Q&A

What precautions should be taken when handling (2-Fluoro-5-formylphenyl)boronic acid (CAS: 352534-79-3)?

Answer

(2-Fluoro-5-formylphenyl)boronic acid
When handling (2-Fluoro-5-formylphenyl)boronic acid, it is essential to wear appropriate personal protective equipment (PPE), including gloves, safety goggles, and a lab coat. This compound should be handled in a well-ventilated area or a fume hood to minimize exposure. In case of spill, immediately clean up using appropriate absorbent materials and dispose of them according to local regulations. Always refer to the safety data sheet (SDS) for detailed handling and disposal procedures.

About

English Name (2-Fluoro-5-formylphenyl)boronic acid
Molecular Formula C7H6BFO3
Molecular Weight 167.93 g/mol
SMILES B(C1=C(C=CC(=C1)C=O)F)(O)O
InChIKey SQSWYWCEKCVQEA-UHFFFAOYSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2-Fluoro-5-formylphenyl)boronic acid (CAS: 352534-79-3)?

(2-Fluoro-5-formylphenyl)boronic acid is a white crystalline solid with a molecular weight of approx...

Compound Q&A

How is (2-Fluoro-5-formylphenyl)boronic acid (CAS: 352534-79-3) typically synthesized?

(2-Fluoro-5-formylphenyl)boronic acid can be synthesized through a multistep process. A common metho...

Compound Q&A

What industries use (2-Fluoro-5-formylphenyl)boronic acid (CAS: 352534-79-3)?

(2-Fluoro-5-formylphenyl)boronic acid is primarily used in pharmaceuticals for the synthesis of drug...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...