Compound Q&A

What industries use (2-Fluoro-5-formylphenyl)boronic acid (CAS: 352534-79-3)?

Answer

(2-Fluoro-5-formylphenyl)boronic acid
(2-Fluoro-5-formylphenyl)boronic acid is primarily used in pharmaceuticals for the synthesis of drug intermediates, as well as in the field of organic chemistry for various reactions. It also finds applications in the development of sensors and semiconductors due to its unique chemical properties and reactivity.

About

English Name (2-Fluoro-5-formylphenyl)boronic acid
Molecular Formula C7H6BFO3
Molecular Weight 167.93 g/mol
SMILES B(C1=C(C=CC(=C1)C=O)F)(O)O
InChIKey SQSWYWCEKCVQEA-UHFFFAOYSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2-Fluoro-5-formylphenyl)boronic acid (CAS: 352534-79-3)?

(2-Fluoro-5-formylphenyl)boronic acid is a white crystalline solid with a molecular weight of approx...

Compound Q&A

How is (2-Fluoro-5-formylphenyl)boronic acid (CAS: 352534-79-3) typically synthesized?

(2-Fluoro-5-formylphenyl)boronic acid can be synthesized through a multistep process. A common metho...

Compound Q&A

What precautions should be taken when handling (2-Fluoro-5-formylphenyl)boronic acid (CAS: 352534-79-3)?

When handling (2-Fluoro-5-formylphenyl)boronic acid, it is essential to wear appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...