Compound Q&A

What are the physical and chemical properties of (2-Fluoro-5-formylphenyl)boronic acid (CAS: 352534-79-3)?

Answer

(2-Fluoro-5-formylphenyl)boronic acid
(2-Fluoro-5-formylphenyl)boronic acid is a white crystalline solid with a molecular weight of approximately 228.11 g/mol. It has a melting point around 128-129°C. The compound is soluble in organic solvents like methanol and ethanol but slightly soluble in water. It exhibits moderate reactivity, particularly towards nucleophilic substitution reactions, and shows basic behavior due to the presence of the boronic acid moiety.

About

English Name (2-Fluoro-5-formylphenyl)boronic acid
Molecular Formula C7H6BFO3
Molecular Weight 167.93 g/mol
SMILES B(C1=C(C=CC(=C1)C=O)F)(O)O
InChIKey SQSWYWCEKCVQEA-UHFFFAOYSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

How is (2-Fluoro-5-formylphenyl)boronic acid (CAS: 352534-79-3) typically synthesized?

(2-Fluoro-5-formylphenyl)boronic acid can be synthesized through a multistep process. A common metho...

Compound Q&A

What industries use (2-Fluoro-5-formylphenyl)boronic acid (CAS: 352534-79-3)?

(2-Fluoro-5-formylphenyl)boronic acid is primarily used in pharmaceuticals for the synthesis of drug...

Compound Q&A

What precautions should be taken when handling (2-Fluoro-5-formylphenyl)boronic acid (CAS: 352534-79-3)?

When handling (2-Fluoro-5-formylphenyl)boronic acid, it is essential to wear appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...