Compound Q&A

How is (2-Fluoro-5-formylphenyl)boronic acid (CAS: 352534-79-3) typically synthesized?

Answer

(2-Fluoro-5-formylphenyl)boronic acid
(2-Fluoro-5-formylphenyl)boronic acid can be synthesized through a multistep process. A common method involves the coupling of 5-formyl-2-fluorophenol with boronic acid derivatives using an appropriate catalyst, such as tetrakis(triphenylphosphine)palladium(0), in the presence of a base like triethylamine. The reaction typically yields a high purity product with good selectivity and yield.

About

English Name (2-Fluoro-5-formylphenyl)boronic acid
Molecular Formula C7H6BFO3
Molecular Weight 167.93 g/mol
SMILES B(C1=C(C=CC(=C1)C=O)F)(O)O
InChIKey SQSWYWCEKCVQEA-UHFFFAOYSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2-Fluoro-5-formylphenyl)boronic acid (CAS: 352534-79-3)?

(2-Fluoro-5-formylphenyl)boronic acid is a white crystalline solid with a molecular weight of approx...

Compound Q&A

What industries use (2-Fluoro-5-formylphenyl)boronic acid (CAS: 352534-79-3)?

(2-Fluoro-5-formylphenyl)boronic acid is primarily used in pharmaceuticals for the synthesis of drug...

Compound Q&A

What precautions should be taken when handling (2-Fluoro-5-formylphenyl)boronic acid (CAS: 352534-79-3)?

When handling (2-Fluoro-5-formylphenyl)boronic acid, it is essential to wear appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...