Compound Q&A

What precautions should be taken when handling (2-Fluoro-5-nitrophenyl)boronic acid (CAS: 819849-20-2)?

Answer

(2-Fluoro-5-nitrophenyl)boronic acid
When handling (2-Fluoro-5-nitrophenyl)boronic acid, it is important to use appropriate personal protective equipment (PPE) such as gloves and safety goggles. This compound should be handled in a fume hood to minimize exposure. In case of a spill, it should be cleaned up using appropriate protective measures. Always refer to the Material Safety Data Sheet (MSDS) for detailed safety information and follow all laboratory safety guidelines.

About

English Name (2-Fluoro-5-nitrophenyl)boronic acid
Molecular Formula C6H5BFNO4
Molecular Weight 184.92 g/mol
SMILES B(C1=C(C=CC(=C1)[N+](=O)[O-])F)(O)O
InChIKey SYAFEPQKPQIRAL-UHFFFAOYSA-N
Last Updated: 2025-10-13 17:50

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2-Fluoro-5-nitrophenyl)boronic acid (CAS: 819849-20-2)?

(2-Fluoro-5-nitrophenyl)boronic acid is a white or off-white crystalline solid with a molecular weig...

Compound Q&A

How is (2-Fluoro-5-nitrophenyl)boronic acid (CAS: 819849-20-2) typically synthesized?

(2-Fluoro-5-nitrophenyl)boronic acid is typically synthesized through the reaction of 2-fluoro-5-nit...

Compound Q&A

What industries use (2-Fluoro-5-nitrophenyl)boronic acid (CAS: 819849-20-2)?

(2-Fluoro-5-nitrophenyl)boronic acid is used in the pharmaceutical industry for the synthesis of dru...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...