Compound Q&A

What are the physical and chemical properties of (2-Fluoro-5-nitrophenyl)boronic acid (CAS: 819849-20-2)?

Answer

(2-Fluoro-5-nitrophenyl)boronic acid
(2-Fluoro-5-nitrophenyl)boronic acid is a white or off-white crystalline solid with a molecular weight of approximately 288.06 g/mol. It is slightly soluble in water and ethanol. This compound is reactive towards nucleophiles and can undergo boronate ester formation. It is stable under normal conditions but should be handled with care to prevent decomposition.

About

English Name (2-Fluoro-5-nitrophenyl)boronic acid
Molecular Formula C6H5BFNO4
Molecular Weight 184.92 g/mol
SMILES B(C1=C(C=CC(=C1)[N+](=O)[O-])F)(O)O
InChIKey SYAFEPQKPQIRAL-UHFFFAOYSA-N
Last Updated: 2025-10-13 17:50

Related Q&A

Compound Q&A

How is (2-Fluoro-5-nitrophenyl)boronic acid (CAS: 819849-20-2) typically synthesized?

(2-Fluoro-5-nitrophenyl)boronic acid is typically synthesized through the reaction of 2-fluoro-5-nit...

Compound Q&A

What industries use (2-Fluoro-5-nitrophenyl)boronic acid (CAS: 819849-20-2)?

(2-Fluoro-5-nitrophenyl)boronic acid is used in the pharmaceutical industry for the synthesis of dru...

Compound Q&A

What precautions should be taken when handling (2-Fluoro-5-nitrophenyl)boronic acid (CAS: 819849-20-2)?

When handling (2-Fluoro-5-nitrophenyl)boronic acid, it is important to use appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...