Compound Q&A

What industries use (2-Fluoro-5-nitrophenyl)boronic acid (CAS: 819849-20-2)?

Answer

(2-Fluoro-5-nitrophenyl)boronic acid
(2-Fluoro-5-nitrophenyl)boronic acid is used in the pharmaceutical industry for the synthesis of drug precursors. It also finds applications in the polymer industry, particularly in the production of functional polymers. Additionally, it is used in the electronics industry for the development of sensors and semiconductors.

About

English Name (2-Fluoro-5-nitrophenyl)boronic acid
Molecular Formula C6H5BFNO4
Molecular Weight 184.92 g/mol
SMILES B(C1=C(C=CC(=C1)[N+](=O)[O-])F)(O)O
InChIKey SYAFEPQKPQIRAL-UHFFFAOYSA-N
Last Updated: 2025-10-13 17:50

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2-Fluoro-5-nitrophenyl)boronic acid (CAS: 819849-20-2)?

(2-Fluoro-5-nitrophenyl)boronic acid is a white or off-white crystalline solid with a molecular weig...

Compound Q&A

How is (2-Fluoro-5-nitrophenyl)boronic acid (CAS: 819849-20-2) typically synthesized?

(2-Fluoro-5-nitrophenyl)boronic acid is typically synthesized through the reaction of 2-fluoro-5-nit...

Compound Q&A

What precautions should be taken when handling (2-Fluoro-5-nitrophenyl)boronic acid (CAS: 819849-20-2)?

When handling (2-Fluoro-5-nitrophenyl)boronic acid, it is important to use appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...