Compound Q&A

How is (2-Fluoro-5-nitrophenyl)boronic acid (CAS: 819849-20-2) typically synthesized?

Answer

(2-Fluoro-5-nitrophenyl)boronic acid
(2-Fluoro-5-nitrophenyl)boronic acid is typically synthesized through the reaction of 2-fluoro-5-nitrophenol with boron tribromide in anhydrous dichloromethane. This method provides a high yield and good selectivity. Other synthetic routes include the use of other boron sources like boronate esters or boronates under various conditions.

About

English Name (2-Fluoro-5-nitrophenyl)boronic acid
Molecular Formula C6H5BFNO4
Molecular Weight 184.92 g/mol
SMILES B(C1=C(C=CC(=C1)[N+](=O)[O-])F)(O)O
InChIKey SYAFEPQKPQIRAL-UHFFFAOYSA-N
Last Updated: 2025-10-13 17:50

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2-Fluoro-5-nitrophenyl)boronic acid (CAS: 819849-20-2)?

(2-Fluoro-5-nitrophenyl)boronic acid is a white or off-white crystalline solid with a molecular weig...

Compound Q&A

What industries use (2-Fluoro-5-nitrophenyl)boronic acid (CAS: 819849-20-2)?

(2-Fluoro-5-nitrophenyl)boronic acid is used in the pharmaceutical industry for the synthesis of dru...

Compound Q&A

What precautions should be taken when handling (2-Fluoro-5-nitrophenyl)boronic acid (CAS: 819849-20-2)?

When handling (2-Fluoro-5-nitrophenyl)boronic acid, it is important to use appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...