Compound Q&A

What precautions should be taken when handling 2-Amino-5-methoxybenzenesulfonic acid (CAS: 13244-33-2)?

Answer

2-Amino-5-methoxybenzenesulfonic acid
Handling 2-Amino-5-methoxybenzenesulfonic acid requires caution due to its potential for skin irritation and respiratory sensitization. Adequate Personal Protective Equipment (PPE) such as gloves, goggles, and protective clothing should be worn. Work should be conducted in a fume hood to minimize exposure. Spills should be handled with appropriate absorbents, and the material safety data sheet (SDS) should be consulted for detailed spill cleanup procedures.

About

CAS No 13244-33-2
English Name 2-Amino-5-methoxybenzenesulfonic acid
Molecular Formula C7H9NO4S
Molecular Weight 203.22 g/mol
SMILES COC1=CC(=C(C=C1)N)S(=O)(=O)O
InChIKey KZKGEEGADAWJFS-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Amino-5-methoxybenzenesulfonic acid (CAS: 13244-33-2)?

2-Amino-5-methoxybenzenesulfonic acid (CAS: 13244-33-2) is a white crystalline solid with a molecula...

Compound Q&A

How is 2-Amino-5-methoxybenzenesulfonic acid (CAS: 13244-33-2) typically synthesized?

2-Amino-5-methoxybenzenesulfonic acid is typically synthesized via the sulfonation of 5-methoxy-anis...

Compound Q&A

What industries use 2-Amino-5-methoxybenzenesulfonic acid (CAS: 13244-33-2)?

2-Amino-5-methoxybenzenesulfonic acid is used in various industries, including pharmaceuticals, wher...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...