Compound Q&A

What industries use 2-Amino-5-methoxybenzenesulfonic acid (CAS: 13244-33-2)?

Answer

2-Amino-5-methoxybenzenesulfonic acid
2-Amino-5-methoxybenzenesulfonic acid is used in various industries, including pharmaceuticals, where it serves as an intermediate in the synthesis of certain drugs. It is also used in the production of dyes and pigments, as a reagent in analytical chemistry, and in the development of sensors and semiconductors.

About

CAS No 13244-33-2
English Name 2-Amino-5-methoxybenzenesulfonic acid
Molecular Formula C7H9NO4S
Molecular Weight 203.22 g/mol
SMILES COC1=CC(=C(C=C1)N)S(=O)(=O)O
InChIKey KZKGEEGADAWJFS-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Amino-5-methoxybenzenesulfonic acid (CAS: 13244-33-2)?

2-Amino-5-methoxybenzenesulfonic acid (CAS: 13244-33-2) is a white crystalline solid with a molecula...

Compound Q&A

How is 2-Amino-5-methoxybenzenesulfonic acid (CAS: 13244-33-2) typically synthesized?

2-Amino-5-methoxybenzenesulfonic acid is typically synthesized via the sulfonation of 5-methoxy-anis...

Compound Q&A

What precautions should be taken when handling 2-Amino-5-methoxybenzenesulfonic acid (CAS: 13244-33-2)?

Handling 2-Amino-5-methoxybenzenesulfonic acid requires caution due to its potential for skin irrita...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...