Compound Q&A

How is 2-Amino-5-methoxybenzenesulfonic acid (CAS: 13244-33-2) typically synthesized?

Answer

2-Amino-5-methoxybenzenesulfonic acid
2-Amino-5-methoxybenzenesulfonic acid is typically synthesized via the sulfonation of 5-methoxy-anisidine followed by sulfonation. Common methods involve the use of fuming sulfuric acid or oleum as the sulfonating agent. The reaction is carried out under controlled temperature conditions to achieve high selectivity and yield.

About

CAS No 13244-33-2
English Name 2-Amino-5-methoxybenzenesulfonic acid
Molecular Formula C7H9NO4S
Molecular Weight 203.22 g/mol
SMILES COC1=CC(=C(C=C1)N)S(=O)(=O)O
InChIKey KZKGEEGADAWJFS-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Amino-5-methoxybenzenesulfonic acid (CAS: 13244-33-2)?

2-Amino-5-methoxybenzenesulfonic acid (CAS: 13244-33-2) is a white crystalline solid with a molecula...

Compound Q&A

What industries use 2-Amino-5-methoxybenzenesulfonic acid (CAS: 13244-33-2)?

2-Amino-5-methoxybenzenesulfonic acid is used in various industries, including pharmaceuticals, wher...

Compound Q&A

What precautions should be taken when handling 2-Amino-5-methoxybenzenesulfonic acid (CAS: 13244-33-2)?

Handling 2-Amino-5-methoxybenzenesulfonic acid requires caution due to its potential for skin irrita...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...