Compound Q&A

What are the physical and chemical properties of 2-Amino-5-methoxybenzenesulfonic acid (CAS: 13244-33-2)?

Answer

2-Amino-5-methoxybenzenesulfonic acid
2-Amino-5-methoxybenzenesulfonic acid (CAS: 13244-33-2) is a white crystalline solid with a molecular weight of approximately 234.22 g/mol. It has a solubility of about 20 g/L in water at 25°C. It is moderately reactive, especially in acidic conditions, and can undergo substitution reactions and coupling reactions. It is slightly soluble in common organic solvents like ethanol and acetone.

About

CAS No 13244-33-2
English Name 2-Amino-5-methoxybenzenesulfonic acid
Molecular Formula C7H9NO4S
Molecular Weight 203.22 g/mol
SMILES COC1=CC(=C(C=C1)N)S(=O)(=O)O
InChIKey KZKGEEGADAWJFS-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

How is 2-Amino-5-methoxybenzenesulfonic acid (CAS: 13244-33-2) typically synthesized?

2-Amino-5-methoxybenzenesulfonic acid is typically synthesized via the sulfonation of 5-methoxy-anis...

Compound Q&A

What industries use 2-Amino-5-methoxybenzenesulfonic acid (CAS: 13244-33-2)?

2-Amino-5-methoxybenzenesulfonic acid is used in various industries, including pharmaceuticals, wher...

Compound Q&A

What precautions should be taken when handling 2-Amino-5-methoxybenzenesulfonic acid (CAS: 13244-33-2)?

Handling 2-Amino-5-methoxybenzenesulfonic acid requires caution due to its potential for skin irrita...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...