2,5-Dioxo-3-pyrrolidinecarboxylic acid

Basic Information

View in Editor

CAS Number

96905-69-0

Molecular Formula

C5H5NO4

Molecular Weight

143.1 g/mol

Chemical Classification

Basic Chemical Raw Materials Organic Chemicals Carboxylic Acids

Basic Chemical Raw Materials Organic Chemicals Heterocyclic Compounds

Pharmaceutical Chemicals Pharmaceutical Intermediates Heterocyclic Intermediates

Water Treatment Chemicals Coagulants and Flocculants Inorganic Coagulants

Basic Physical Properties

Density

1.590

SMILES

View in Editor

C1C(C(=O)NC1=O)C(=O)O

InChI

InChI=1S/C5H5NO4/c7-3-1-2(5(9)10)4(8)6-3/h2H,1H2,(H,9,10)(H,6,7,8)

InChIKey

AZPXZTOCIRKBSJ-UHFFFAOYSA-N

LogP

-1.2662999999999998

Topological Polar Surface Area

83.47 Å²

Hydrogen Bond Donor/Acceptor

2 / 5

Synonyms & References

English

2,5-dioxopyrrolidine-3-carboxylic acid
3-pyrrolidinecarboxylic acid, 2,5-dioxo-
LogP
2,5-Dioxo-3-pyrrolidinecarboxylic acid

MDL Number

MFCD16039577

FAQ

What are the physical and chemical properties of 2,5-Dioxo-3-pyrrolidinecarboxylic acid (CAS: 96905-69-0)?

2,5-Dioxo-3-pyrrolidinecarboxylic acid is a white crystalline solid with a molecular weight of 130.09 g/mol. It is poorly soluble in water but readily soluble in organic solvents like methanol and ethanol. Chemically, it is highly reactive, particularly towards nucleophiles, and is used in various synthetic transformations due to its carboxylic acid and pyrrolidine functionalities.

How is 2,5-Dioxo-3-pyrrolidinecarboxylic acid (CAS: 96905-69-0) typically synthesized?

2,5-Dioxo-3-pyrrolidinecarboxylic acid can be synthesized through the dehydrative condensation of pyrrolidinecarboxylic acid with phosgene. Alternatively, it can be prepared by the condensation of 1,5-dioxepan-2-one with glycine. The synthesis typically involves the use of a dehydrating agent and a mild base, with high yields and good selectivity.

What industries use 2,5-Dioxo-3-pyrrolidinecarboxylic acid (CAS: 96905-69-0)?

2,5-Dioxo-3-pyrrolidinecarboxylic acid is used in pharmaceuticals for the synthesis of certain drugs, in polymers as a monomer, and in sensors for detecting various analytes. It also finds applications in the synthesis of functional materials and semiconductors due to its unique chemical properties.

What precautions should be taken when handling 2,5-Dioxo-3-pyrrolidinecarboxylic acid (CAS: 96905-69-0)?

When handling 2,5-Dioxo-3-pyrrolidinecarboxylic acid, ensure proper ventilation and use a fume hood to minimize inhalation risks. Wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Spills should be cleaned up immediately using appropriate absorbents, and the material safety data sheet (SDS) should be consulted for detailed safety information.