Methyl 5-hexynoate | CAS No. 77758-51-1
Methyl 5-hexynoate
Basic Information
CAS Number
77758-51-1
Molecular Formula
C7H10O2
Molecular Weight
116.16 g/mol
Basic Physical Properties
Boiling Point
60 °C
Refractive Index
1.434
Synonyms & References
English
- MFCD00671366
- Methyl 5-hexynoate, AldrichCPR
- BCP22814
- SY275105
- PROCATEROLHYDROCHLORIDE
- Hex-5-ynoic acid, methyl ester
- Hex-5-ynoic acid methyl ester
- Methyl 5-hexynoate #
- Methyl 5-?Hexynoate
- 5-hexynoic acid methyl ester
- CDA75851
- FT-0740703
- InChI=1/C7H10O2/c1-3-4-5-6-7(8)9-2/h1H,4-6H2,2H
- CS-0127624
- C90747
- Methyl 5-hexynoate
- 5-Hexynoic acid, methyl ester
- AKOS022189953
- SCHEMBL1444871
- methyl hex-5-ynoate
- 77758-51-1
- AS-57079
- Methyl hex-5-ynoate
- Methyl5-hexynoate
- 5-Hexynoic acid, methylester
MDL Number
MFCD00671366
FAQ
What are the physical and chemical properties of Methyl 5-hexynoate (CAS: 77758-51-1)?
How is Methyl 5-hexynoate (CAS: 77758-51-1) typically synthesized?
What industries use Methyl 5-hexynoate (CAS: 77758-51-1)?
What precautions should be taken when handling Methyl 5-hexynoate (CAS: 77758-51-1)?
Related Compounds
N-(2-Methoxyphenyl)-N-[(4-methylphenyl)sulfonyl]-beta-alanine
5'-O-[Bis(4-methoxyphenyl)(phenyl)methyl]cytidine
(3S,4R)-3-Hydroxy-2,2-dimethyl-4-[(3-oxo-1-cyclopenten-1-yl)oxy]-6-chromanecarbonitrile
Methyl 5-chloropyrazolo[1,5-a]pyrimidine-2-carboxylate
You might also like
What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?
6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...
What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?
4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...
What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?
2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...
What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?
2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...
What is 2-Oxopropanamide (CAS: 631-66-3)?
2-Oxopropanamide, also known as 2-aminoacrylic acid, is a chemical compound with...
What is 2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CAS: 1289040-88-5)?
2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CA...
What is NAMPT inhibitor-linker 1 (CAS: 2241019-57-6)?
NAMPT inhibitor-linker 1 (CAS: 2241019-57-6) is a chemical compound designed as ...
What is (2-(2,2,2-Trifluoroacetyl)pyridin-4-yl)boronic acid (CAS: 1310404-58-0)?
It is a chemical compound with the structure (2-(2,2,2-Trifluoroacetyl)pyridin-4...
What is 1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one (CAS: 794568-90-4)?
1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,...
What is Vinyl(chloromethyl)dimethoxysilane (CAS: 1314981-48-0)?
Vinyl(chloromethyl)dimethoxysilane is an organosilicon compound with the molecul...



![N-(2-Methoxyphenyl)-N-[(4-methylphenyl)sulfonyl]-beta-alanine structure N-(2-Methoxyphenyl)-N-[(4-methylphenyl)sulfonyl]-beta-alanine structure](https://static.chemtradehub.com/structs/103/103687-96-3-8086.webp)
![5'-O-[Bis(4-methoxyphenyl)(phenyl)methyl]cytidine structure 5'-O-[Bis(4-methoxyphenyl)(phenyl)methyl]cytidine structure](https://static.chemtradehub.com/structs/112/112897-99-1-d1f4.webp)



![(3S,4R)-3-Hydroxy-2,2-dimethyl-4-[(3-oxo-1-cyclopenten-1-yl)oxy]-6-chromanecarbonitrile structure (3S,4R)-3-Hydroxy-2,2-dimethyl-4-[(3-oxo-1-cyclopenten-1-yl)oxy]-6-chromanecarbonitrile structure](https://static.chemtradehub.com/structs/121/121055-10-5-583d.webp)
![Methyl 5-chloropyrazolo[1,5-a]pyrimidine-2-carboxylate structure Methyl 5-chloropyrazolo[1,5-a]pyrimidine-2-carboxylate structure](https://static.chemtradehub.com/structs/126/1263059-26-2-d6da.webp)









