1-Ethyl-1H-imidazole-4-carboxylic acid | CAS No. 71925-07-0

1-Ethyl-1H-imidazole-4-carboxylic acid

Basic Information

CAS Number

71925-07-0

Molecular Formula

C6H8N2O2

Molecular Weight

140.14 g/mol

AD

Basic Physical Properties

CCn1cnc(c1)C(=O)O

InChI

InChI=1S/C6H8N2O2/c1-2-8-3-5(6(9)10)7-4-8/h3-4H,2H2,1H3,(H,9,10)

InChIKey

GWKQLHRGJVYPOJ-UHFFFAOYSA-N

LogP

0.6012

Topological Polar Surface Area

55.120000000000005 Ų

Hydrogen Bond Donor/Acceptor

1 / 4

Synonyms & References

English

  • 1-ethyl-1H-imidazole-4-carboxylic acid

MDL Number

MFCD07376008

FAQ

What are the physical and chemical properties of 1-Ethyl-1H-imidazole-4-carboxylic acid (CAS: 71925-07-0)?

1-Ethyl-1H-imidazole-4-carboxylic acid is a crystalline solid with a molecular weight of approximately 150.22 g/mol. It has limited water solubility and is moderately soluble in organic solvents. This compound is known for its reactivity towards nucleophiles and its ability to form stable complexes with metal ions. It also exhibits basic properties due to the imidazole ring.

How is 1-Ethyl-1H-imidazole-4-carboxylic acid (CAS: 71925-07-0) typically synthesized?

1-Ethyl-1H-imidazole-4-carboxylic acid can be synthesized by the coupling of ethyl acetoacetate with 1H-imidazole in the presence of a base like sodium hydroxide. This reaction involves the nucleophilic substitution of the acetoacetate group by the amino group of imidazole. The yield can be improved by using a suitable solvent and ensuring proper mixing and temperature control.

What industries use 1-Ethyl-1H-imidazole-4-carboxylic acid (CAS: 71925-07-0)?

1-Ethyl-1H-imidazole-4-carboxylic acid finds applications in various industries. It is used in pharmaceuticals for the synthesis of certain drugs, in polymers as a monomer, and in sensors for detection of specific analytes. Additionally, it has potential uses in the semiconductor industry for the fabrication of electronic devices.

What precautions should be taken when handling 1-Ethyl-1H-imidazole-4-carboxylic acid (CAS: 71925-07-0)?

When handling 1-Ethyl-1H-imidazole-4-carboxylic acid, it is important to use appropriate personal protective equipment (PPE), including gloves, goggles, and a lab coat. Ensure the use of a fume hood during synthesis and handling to avoid inhalation. Spills should be cleaned up immediately using appropriate absorbents, and the material should be disposed of according to local regulations. Refer to the safety data sheet (SDS) for detailed information on handling and disposal.

Related Compounds

You might also like

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...
Compound Q&A

What is 2-Oxopropanamide (CAS: 631-66-3)?

2-Oxopropanamide, also known as 2-aminoacrylic acid, is a chemical compound with...

631-66-32-Oxopropanamide
Compound Q&A

What is 2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CAS: 1289040-88-5)?

2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CA...

1289040-88-52-Methyl-2-propanyl ...
Compound Q&A

What is NAMPT inhibitor-linker 1 (CAS: 2241019-57-6)?

NAMPT inhibitor-linker 1 (CAS: 2241019-57-6) is a chemical compound designed as ...

2241019-57-6NAMPT inhibitor-link...
Compound Q&A

What is (2-(2,2,2-Trifluoroacetyl)pyridin-4-yl)boronic acid (CAS: 1310404-58-0)?

It is a chemical compound with the structure (2-(2,2,2-Trifluoroacetyl)pyridin-4...

1310404-58-0(2-(2,2,2-Trifluoroa...
Compound Q&A

What is 1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one (CAS: 794568-90-4)?

1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,...

794568-90-41-(2-Chlorophenyl)-6...
Compound Q&A

What is Vinyl(chloromethyl)dimethoxysilane (CAS: 1314981-48-0)?

Vinyl(chloromethyl)dimethoxysilane is an organosilicon compound with the molecul...

1314981-48-0Vinyl(chloromethyl)d...