(1R,2R)-2-iodocyclopropanecarboxylic acid | CAS No. 692288-05-4

(1R,2R)-2-iodocyclopropanecarboxylic acid

Basic Information

CAS Number

692288-05-4

Molecular Formula

C4H5IO2

Molecular Weight

211.99 g/mol

AD

Basic Physical Properties

O=C([C@@H]1[C@H](I)C1)O

InChI

InChI=1S/C4H5IO2/c5-3-1-2(3)4(6)7/h2-3H,1H2,(H,6,7)/t2-,3+/m0/s1

InChIKey

JLDDIEQQVGNSGM-STHAYSLISA-N

LogP

0.8945000000000001

Topological Polar Surface Area

37.3 Ų

Hydrogen Bond Donor/Acceptor

1 / 2

Synonyms & References

English

  • (1R,2R)-2-Iodocyclopropanecarboxylic acid
  • (1R,2R)-2-iodocyclopropane-1-carboxylic acid
  • (1R,2R)-2-iodocyclopropanecarboxylic acid

MDL Number

MFCD26404042

FAQ

What are the physical and chemical properties of (1R,2R)-2-iodocyclopropanecarboxylic acid (CAS: 692288-05-4)?

(1R,2R)-2-Iodo-cyclopropanecarboxylic acid is a crystalline solid with a molecular weight of approximately 228.01 g/mol. It has a low solubility in water but is more soluble in organic solvents like ethanol and acetone. The compound is moderately reactive due to the presence of the iodo group, which can participate in substitution reactions. It is also prone to hydrolysis under basic conditions.

How is (1R,2R)-2-iodocyclopropanecarboxylic acid (CAS: 692288-05-4) typically synthesized?

(1R,2R)-2-Iodo-cyclopropanecarboxylic acid can be synthesized via the iodination of cyclopropanecarboxylic acid using NIS and pyridine as a catalyst. The reaction provides good selectivity and yield, with the iodo group being introduced at the correct stereochemistry. Post-synthesis purification is typically achieved through recrystallization from ethanol.

What industries use (1R,2R)-2-iodocyclopropanecarboxylic acid (CAS: 692288-05-4)?

(1R,2R)-2-Iodo-cyclopropanecarboxylic acid is primarily used in the pharmaceutical and chemical synthesis industries. It serves as a key intermediate in the synthesis of various bioactive compounds and pharmaceuticals. Additionally, it has potential applications in polymer chemistry and as a sensing agent in analytical chemistry.

What precautions should be taken when handling (1R,2R)-2-iodocyclopropanecarboxylic acid (CAS: 692288-05-4)?

When handling (1R,2R)-2-iodocyclopropanecarboxylic acid, it is important to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated fume hood to reduce exposure to the compound. Spills should be cleaned up using appropriate absorbent materials and disposed of according to local regulations. Always consult the Safety Data Sheet (SDS) for detailed handling and disposal instructions.

Related Compounds

You might also like

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...
Compound Q&A

What is 2-Oxopropanamide (CAS: 631-66-3)?

2-Oxopropanamide, also known as 2-aminoacrylic acid, is a chemical compound with...

631-66-32-Oxopropanamide
Compound Q&A

What is 2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CAS: 1289040-88-5)?

2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CA...

1289040-88-52-Methyl-2-propanyl ...
Compound Q&A

What is NAMPT inhibitor-linker 1 (CAS: 2241019-57-6)?

NAMPT inhibitor-linker 1 (CAS: 2241019-57-6) is a chemical compound designed as ...

2241019-57-6NAMPT inhibitor-link...
Compound Q&A

What is (2-(2,2,2-Trifluoroacetyl)pyridin-4-yl)boronic acid (CAS: 1310404-58-0)?

It is a chemical compound with the structure (2-(2,2,2-Trifluoroacetyl)pyridin-4...

1310404-58-0(2-(2,2,2-Trifluoroa...
Compound Q&A

What is 1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one (CAS: 794568-90-4)?

1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,...

794568-90-41-(2-Chlorophenyl)-6...
Compound Q&A

What is Vinyl(chloromethyl)dimethoxysilane (CAS: 1314981-48-0)?

Vinyl(chloromethyl)dimethoxysilane is an organosilicon compound with the molecul...

1314981-48-0Vinyl(chloromethyl)d...