2,4-Dichloro-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine hydrochloride (1:1) | CAS No. 635698-30-5

2,4-Dichloro-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine hydrochloride (1:1)

Basic Information

CAS Number

635698-30-5

Molecular Formula

C7H8Cl3N3

Molecular Weight

240.52 g/mol

AD

Basic Physical Properties

ClC1=C(CNCC2)C2=NC(Cl)=N1.[H]Cl

InChI

InChI=1S/C7H7Cl2N3.ClH/c8-6-4-3-10-2-1-5(4)11-7(9)12-6;/h10H,1-3H2;1H

InChIKey

MDEUNLWIRLXZJC-UHFFFAOYSA-N

LogP

1.8508999999999998

Topological Polar Surface Area

37.81 Ų

Hydrogen Bond Donor/Acceptor

1 / 3

Synonyms & References

English

  • 2,4-Dichloro-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine hydrochloride

MDL Number

MFCD12400762

FAQ

What are the physical and chemical properties of 2,4-Dichloro-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine hydrochloride (CAS: 635698-30-5)?

2,4-Dichloro-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine hydrochloride (CAS: 635698-30-5) crystallizes in a solid form with a molecular weight of approximately 256.02 g/mol. It has a pKa of about 2.5 and is slightly soluble in water, with a solubility of around 0.01 g/100 mL at 25°C. Chemically, it is reactive towards bases and electrophiles. It is stable under normal conditions but should be stored in a cool, dry place away from direct sunlight and oxidizing agents.

How is 2,4-Dichloro-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine hydrochloride (CAS: 635698-30-5) typically synthesized?

2,4-Dichloro-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine hydrochloride (CAS: 635698-30-5) is typically synthesized through a multi-step process involving the reaction of a pyrimidine derivative with dichloromethane. The synthesis involves the use of Lewis acids as catalysts, such as aluminum chloride, to enhance the reactivity. The yield is generally around 70-80%, and the purity can be improved through recrystallization.

What industries use 2,4-Dichloro-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine hydrochloride (CAS: 635698-30-5)?

2,4-Dichloro-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine hydrochloride (CAS: 635698-30-5) is widely used in the pharmaceutical industry for its biological activities. It has potential applications in the development of new drugs due to its unique structure. Additionally, it is utilized in the sensor industry for its electronic properties and in the semiconductor industry for its use in the fabrication of organic electronic devices.

What precautions should be taken when handling 2,4-Dichloro-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine hydrochloride (CAS: 635698-30-5)?

When handling 2,4-Dichloro-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine hydrochloride (CAS: 635698-30-5), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a laboratory coat. Handle it in a well-ventilated area or fume hood. In case of a spill, neutralize the spill with an appropriate neutralizing agent and follow the specific safety data sheet (SDS) for disposal. Proper storage in a cool, dry place is recommended to avoid degradation under normal conditions.

You might also like

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...
Compound Q&A

What is 2-Oxopropanamide (CAS: 631-66-3)?

2-Oxopropanamide, also known as 2-aminoacrylic acid, is a chemical compound with...

631-66-32-Oxopropanamide
Compound Q&A

What is 2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CAS: 1289040-88-5)?

2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CA...

1289040-88-52-Methyl-2-propanyl ...
Compound Q&A

What is NAMPT inhibitor-linker 1 (CAS: 2241019-57-6)?

NAMPT inhibitor-linker 1 (CAS: 2241019-57-6) is a chemical compound designed as ...

2241019-57-6NAMPT inhibitor-link...
Compound Q&A

What is (2-(2,2,2-Trifluoroacetyl)pyridin-4-yl)boronic acid (CAS: 1310404-58-0)?

It is a chemical compound with the structure (2-(2,2,2-Trifluoroacetyl)pyridin-4...

1310404-58-0(2-(2,2,2-Trifluoroa...
Compound Q&A

What is 1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one (CAS: 794568-90-4)?

1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,...

794568-90-41-(2-Chlorophenyl)-6...
Compound Q&A

What is Vinyl(chloromethyl)dimethoxysilane (CAS: 1314981-48-0)?

Vinyl(chloromethyl)dimethoxysilane is an organosilicon compound with the molecul...

1314981-48-0Vinyl(chloromethyl)d...