Compound Q&A

What industries use 2,4-Dichloro-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine hydrochloride (CAS: 635698-30-5)?

Answer

2,4-Dichloro-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine hydrochloride (1:1)
2,4-Dichloro-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine hydrochloride (CAS: 635698-30-5) is widely used in the pharmaceutical industry for its biological activities. It has potential applications in the development of new drugs due to its unique structure. Additionally, it is utilized in the sensor industry for its electronic properties and in the semiconductor industry for its use in the fabrication of organic electronic devices.

About

English Name 2,4-Dichloro-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine hydrochloride (1:1)
Molecular Formula C7H8Cl3N3
Molecular Weight 240.52 g/mol
SMILES ClC1=C(CNCC2)C2=NC(Cl)=N1.[H]Cl
InChIKey MDEUNLWIRLXZJC-UHFFFAOYSA-N
Last Updated: 2025-12-28 06:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,4-Dichloro-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine hydrochloride (CAS: 635698-30-5)?

2,4-Dichloro-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine hydrochloride (CAS: 635698-30-5) crystallizes...

Compound Q&A

How is 2,4-Dichloro-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine hydrochloride (CAS: 635698-30-5) typically synthesized?

2,4-Dichloro-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine hydrochloride (CAS: 635698-30-5) is typically...

Compound Q&A

What precautions should be taken when handling 2,4-Dichloro-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine hydrochloride (CAS: 635698-30-5)?

When handling 2,4-Dichloro-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine hydrochloride (CAS: 635698-30-5...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...