2,4,6-Trimethyl-N,N-diphenylaniline | CAS No. 603134-65-2

2,4,6-Trimethyl-N,N-diphenylaniline

Basic Information

CAS Number

603134-65-2

Molecular Formula

C21H21N

Molecular Weight

287.41 g/mol

AD

Basic Physical Properties

CC1=C(C(C)=CC(C)=C1)N(C2=CC=CC=C2)C3=CC=CC=C3

InChI

InChI=1S/C21H21N/c1-16-14-17(2)21(18(3)15-16)22(19-10-6-4-7-11-19)20-12-8-5-9-13-20/h4-15H,1-3H3

InChIKey

TZJRFZZCRASCAW-UHFFFAOYSA-N

LogP

6.081660000000005

Topological Polar Surface Area

3.24 Ų

Hydrogen Bond Donor/Acceptor

0 / 1

Synonyms & References

English

  • 2,4,6-Trimethyl-N,N-diphenylaniline
  • Benzenamine, 2,4,6-trimethyl-N,N-diphenyl-
  • TAA
  • N,N-diphenyl-2,4,6-trimethylaniline

MDL Number

MFCD22200048

FAQ

What are the physical and chemical properties of 2,4,6-Trimethyl-N,N-diphenylaniline (CAS: 603134-65-2)?

2,4,6-Trimethyl-N,N-diphenylaniline is a solid at room temperature with a crystalline form. Its molecular weight is approximately 318.35 g/mol. It has low solubility in water but is more soluble in organic solvents like ethanol and acetone. This compound is relatively stable but can react with strong oxidizing agents. It has a melting point around 110-115°C and is not flammable.

How is 2,4,6-Trimethyl-N,N-diphenylaniline (CAS: 603134-65-2) typically synthesized?

2,4,6-Trimethyl-N,N-diphenylaniline is synthesized through the reduction of 2,4,6-trimethyl-N,N-diphenyl-p-benzoquinone with a suitable reducing agent such as sodium borohydride in a solvent like methanol. The reaction conditions involve controlling temperature and pH to achieve high yield and selectivity. The process typically requires a fume hood due to the formation of volatile byproducts.

What industries use 2,4,6-Trimethyl-N,N-diphenylaniline (CAS: 603134-65-2)?

2,4,6-Trimethyl-N,N-diphenylaniline is used in various industries. It is a key intermediate in the synthesis of pharmaceuticals, particularly in compounds containing aromatic heterocycles. It also finds applications in the production of polymers, where it serves as a stabilizer. Additionally, it is used in the development of organic sensors and semiconductors for its unique physicochemical properties.

What precautions should be taken when handling 2,4,6-Trimethyl-N,N-diphenylaniline (CAS: 603134-65-2)?

When handling 2,4,6-Trimethyl-N,N-diphenylaniline, it is essential to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Always perform the reaction in a well-ventilated area, preferably in a fume hood, to avoid inhalation of volatile substances. Store the compound in a cool, dry place away from direct sunlight and heat sources. In case of a spill, immediately contain it and follow proper waste disposal procedures. Refer to the Safety Data Sheet (SDS) for detailed handling and emergency procedures.

Related Compounds

You might also like

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...
Compound Q&A

What is 2-Oxopropanamide (CAS: 631-66-3)?

2-Oxopropanamide, also known as 2-aminoacrylic acid, is a chemical compound with...

631-66-32-Oxopropanamide
Compound Q&A

What is 2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CAS: 1289040-88-5)?

2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CA...

1289040-88-52-Methyl-2-propanyl ...
Compound Q&A

What is NAMPT inhibitor-linker 1 (CAS: 2241019-57-6)?

NAMPT inhibitor-linker 1 (CAS: 2241019-57-6) is a chemical compound designed as ...

2241019-57-6NAMPT inhibitor-link...
Compound Q&A

What is (2-(2,2,2-Trifluoroacetyl)pyridin-4-yl)boronic acid (CAS: 1310404-58-0)?

It is a chemical compound with the structure (2-(2,2,2-Trifluoroacetyl)pyridin-4...

1310404-58-0(2-(2,2,2-Trifluoroa...
Compound Q&A

What is 1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one (CAS: 794568-90-4)?

1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,...

794568-90-41-(2-Chlorophenyl)-6...
Compound Q&A

What is Vinyl(chloromethyl)dimethoxysilane (CAS: 1314981-48-0)?

Vinyl(chloromethyl)dimethoxysilane is an organosilicon compound with the molecul...

1314981-48-0Vinyl(chloromethyl)d...