Compound Q&A

What precautions should be taken when handling 2,4,6-Trimethyl-N,N-diphenylaniline (CAS: 603134-65-2)?

Answer

2,4,6-Trimethyl-N,N-diphenylaniline
When handling 2,4,6-Trimethyl-N,N-diphenylaniline, it is essential to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Always perform the reaction in a well-ventilated area, preferably in a fume hood, to avoid inhalation of volatile substances. Store the compound in a cool, dry place away from direct sunlight and heat sources. In case of a spill, immediately contain it and follow proper waste disposal procedures. Refer to the Safety Data Sheet (SDS) for detailed handling and emergency procedures.

About

English Name 2,4,6-Trimethyl-N,N-diphenylaniline
Molecular Formula C21H21N
Molecular Weight 287.41 g/mol
SMILES CC1=C(C(C)=CC(C)=C1)N(C2=CC=CC=C2)C3=CC=CC=C3
InChIKey TZJRFZZCRASCAW-UHFFFAOYSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,4,6-Trimethyl-N,N-diphenylaniline (CAS: 603134-65-2)?

2,4,6-Trimethyl-N,N-diphenylaniline is a solid at room temperature with a crystalline form. Its mole...

Compound Q&A

How is 2,4,6-Trimethyl-N,N-diphenylaniline (CAS: 603134-65-2) typically synthesized?

2,4,6-Trimethyl-N,N-diphenylaniline is synthesized through the reduction of 2,4,6-trimethyl-N,N-diph...

Compound Q&A

What industries use 2,4,6-Trimethyl-N,N-diphenylaniline (CAS: 603134-65-2)?

2,4,6-Trimethyl-N,N-diphenylaniline is used in various industries. It is a key intermediate in the s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...