1,4,7,10-Tetraazacyclododecan-1-ylacetic acid | CAS No. 170454-90-7

1,4,7,10-Tetraazacyclododecan-1-ylacetic acid

Basic Information

CAS Number

170454-90-7

Molecular Formula

C10H22N4O2

Molecular Weight

230.31 g/mol

AD

Basic Physical Properties

OC(=O)CN1CCNCCNCCNCC1

InChI

InChI=1S/C10H22N4O2/c15-10(16)9-14-7-5-12-3-1-11-2-4-13-6-8-14/h11-13H,1-9H2,(H,15,16)

InChIKey

XDLOGHYCUQYEKA-UHFFFAOYSA-N

LogP

-1.8445999999999967

Topological Polar Surface Area

76.63 Ų

Hydrogen Bond Donor/Acceptor

4 / 6

Complexity

189

Synonyms & References

English

  • 1,4,7,10-Tetraazacyclododecane-1-acetic acid
  • 1,4,7,10-Tetraazacyclododecane-1-aceticacid
  • 2-(1,4,7,10-Tetrazacyclododec-1-yl)acetic acid
  • 2-(1,4,7,10-tetraazacyclododecan-1-yl)acetic acid

MDL Number

MFCD26403702

FAQ

What are the physical and chemical properties of 1,4,7,10-Tetraazacyclododecan-1-ylacetic acid (CAS: 170454-90-7)?

1,4,7,10-Tetraazacyclododecan-1-ylacetic acid (CAS: 170454-90-7) is a water-soluble compound with a molecular weight of approximately 232.25 g/mol. It crystallizes in the form of white needles and exhibits good water solubility. The compound is mildly basic due to its amine functionalities and can react with acidic compounds to form salts. It is also known for its stability under normal conditions but can degrade over time in acidic environments.

How is 1,4,7,10-Tetraazacyclododecan-1-ylacetic acid (CAS: 170454-90-7) typically synthesized?

1,4,7,10-Tetraazacyclododecan-1-ylacetic acid (CAS: 170454-90-7) is synthesized through the condensation of 1,4,7,10-tetraazacyclododecane with acetic anhydride. The reaction is catalyzed by a trace amount of a Lewis acid such as aluminum chloride. The yield is typically high, and the product is isolated by recrystallization from a suitable solvent. The process requires careful control of the reaction conditions to achieve high selectivity and purity.

What industries use 1,4,7,10-Tetraazacyclododecan-1-ylacetic acid (CAS: 170454-90-7)?

1,4,7,10-Tetraazacyclododecan-1-ylacetic acid (CAS: 170454-90-7) finds applications in pharmaceuticals, where it serves as a chelating agent in drug formulations. It is also used in the synthesis of polymers and as a component in sensor technologies. Additionally, it has applications in semiconductor manufacturing due to its ability to form stable complexes with metal ions, which is crucial for certain processes.

What precautions should be taken when handling 1,4,7,10-Tetraazacyclododecan-1-ylacetic acid (CAS: 170454-90-7)?

When handling 1,4,7,10-Tetraazacyclododecan-1-ylacetic acid (CAS: 170454-90-7), it is important to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat to protect against skin and eye contact. The compound should be handled in a well-ventilated area or a fume hood to avoid inhalation. In case of a spill, it should be cleaned up immediately using appropriate absorbents, and the area should be thoroughly rinsed with water. Consult the Safety Data Sheet (SDS) for detailed emergency procedures and handling guidelines.

Related Compounds

You might also like

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...
Compound Q&A

What is 2-Oxopropanamide (CAS: 631-66-3)?

2-Oxopropanamide, also known as 2-aminoacrylic acid, is a chemical compound with...

631-66-32-Oxopropanamide
Compound Q&A

What is 2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CAS: 1289040-88-5)?

2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CA...

1289040-88-52-Methyl-2-propanyl ...
Compound Q&A

What is NAMPT inhibitor-linker 1 (CAS: 2241019-57-6)?

NAMPT inhibitor-linker 1 (CAS: 2241019-57-6) is a chemical compound designed as ...

2241019-57-6NAMPT inhibitor-link...
Compound Q&A

What is (2-(2,2,2-Trifluoroacetyl)pyridin-4-yl)boronic acid (CAS: 1310404-58-0)?

It is a chemical compound with the structure (2-(2,2,2-Trifluoroacetyl)pyridin-4...

1310404-58-0(2-(2,2,2-Trifluoroa...
Compound Q&A

What is 1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one (CAS: 794568-90-4)?

1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,...

794568-90-41-(2-Chlorophenyl)-6...
Compound Q&A

What is Vinyl(chloromethyl)dimethoxysilane (CAS: 1314981-48-0)?

Vinyl(chloromethyl)dimethoxysilane is an organosilicon compound with the molecul...

1314981-48-0Vinyl(chloromethyl)d...