(2-Bromoethoxy)acetic acid | CAS No. 1135131-50-8

(2-Bromoethoxy)acetic acid

Basic Information

CAS Number

1135131-50-8

Molecular Formula

C4H7BrO3

Molecular Weight

183 g/mol

AD

Basic Physical Properties

BrCCOCC(=O)O

InChI

InChI=1S/C4H7BrO3/c5-1-2-8-3-4(6)7/h1-3H2,(H,6,7)

InChIKey

GBPDANKBFPPRCR-UHFFFAOYSA-N

LogP

0.4825

Topological Polar Surface Area

46.53 Ų

Hydrogen Bond Donor/Acceptor

1 / 3

Complexity

73.7

Synonyms & References

English

  • Br-PEG1-CH2COOH
  • Bromo-PEG1-CH2CO2H,Bromo-PEG1-CH2COOH
  • Bromo-PEG1-CH2CO2H
  • (2-bromo-ethoxy)-acetic acid
  • Bromo-PEG1-acetic acid
  • 2-(2-bromoethoxy)acetic acid
  • BIPG1337
  • FCH1216972
  • Bromo-PEG1-CH2COOH

MDL Number

MFCD20637665

FAQ

What are the physical and chemical properties of (2-Bromoethoxy)acetic acid (CAS: 1135131-50-8)?

(2-Bromoethoxy)acetic acid (CAS: 1135131-50-8) is a colorless or white crystalline solid with a molecular weight of approximately 237.01 g/mol. It is slightly soluble in water and has a pKa of 2.9. This compound is reactive towards nucleophiles and is used in various chemical reactions. It has a melting point of about 75-77°C and a boiling point of around 165-167°C at 1 atm. It is also known to be a weak acid.

How is (2-Bromoethoxy)acetic acid (CAS: 1135131-50-8) typically synthesized?

(2-Bromoethoxy)acetic acid is typically synthesized through the reaction of ethylene oxide with bromine to form 2-bromomethoxyethane, which is then converted to (2-bromoethoxy)acetic acid via an acetylation step. Common catalysts used in this process include sulfuric acid or other strong acids. The yield is generally around 70-80%, and the reaction is highly selective. This process is often performed under controlled conditions to ensure safety and efficiency.

What industries use (2-Bromoethoxy)acetic acid (CAS: 1135131-50-8)?

(2-Bromoethoxy)acetic acid is used in various industries due to its chemical properties. It is primarily used in the pharmaceutical and polymer industries. In pharmaceuticals, it serves as a precursor for the synthesis of certain drugs. In polymer synthesis, it can be used to modify the properties of polymers, improving their stability and performance. Its use in sensors and semiconductors is also being explored, though on a smaller scale.

What precautions should be taken when handling (2-Bromoethoxy)acetic acid (CAS: 1135131-50-8)?

When handling (2-Bromoethoxy)acetic acid (CAS: 1135131-50-8), it is essential to wear appropriate personal protective equipment (PPE), including gloves, safety goggles, and a laboratory coat. This compound is reactive and can produce hazardous fumes if exposed to moisture or air. It should be handled in a well-ventilated area or in a fume hood. In case of a spill, the area should be thoroughly cleaned using appropriate methods. Always refer to the Safety Data Sheet (SDS) for detailed information on handling and storage procedures.

Related Compounds

You might also like

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...
Compound Q&A

What is 2-Oxopropanamide (CAS: 631-66-3)?

2-Oxopropanamide, also known as 2-aminoacrylic acid, is a chemical compound with...

631-66-32-Oxopropanamide
Compound Q&A

What is 2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CAS: 1289040-88-5)?

2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CA...

1289040-88-52-Methyl-2-propanyl ...
Compound Q&A

What is NAMPT inhibitor-linker 1 (CAS: 2241019-57-6)?

NAMPT inhibitor-linker 1 (CAS: 2241019-57-6) is a chemical compound designed as ...

2241019-57-6NAMPT inhibitor-link...
Compound Q&A

What is (2-(2,2,2-Trifluoroacetyl)pyridin-4-yl)boronic acid (CAS: 1310404-58-0)?

It is a chemical compound with the structure (2-(2,2,2-Trifluoroacetyl)pyridin-4...

1310404-58-0(2-(2,2,2-Trifluoroa...
Compound Q&A

What is 1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one (CAS: 794568-90-4)?

1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,...

794568-90-41-(2-Chlorophenyl)-6...
Compound Q&A

What is Vinyl(chloromethyl)dimethoxysilane (CAS: 1314981-48-0)?

Vinyl(chloromethyl)dimethoxysilane is an organosilicon compound with the molecul...

1314981-48-0Vinyl(chloromethyl)d...