Compound Q&A

What precautions should be taken when handling Ethyl 7-fluoro-4-hydroxy-6-methoxyquinoline-3-carboxylate (CAS: 622369-35-1)?

Answer

Ethyl 7-fluoro-4-hydroxy-6-methoxyquinoline-3-carboxylate
When handling Ethyl 7-fluoro-4-hydroxy-6-methoxyquinoline-3-carboxylate (CAS: 622369-35-1), it is crucial to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The compound should be handled in a well-ventilated area or under a fume hood. Spills should be cleaned up immediately with appropriate absorbent materials and disposed of according to local regulations. Always consult the Safety Data Sheet (SDS) for detailed handling and safety information.

About

English Name Ethyl 7-fluoro-4-hydroxy-6-methoxyquinoline-3-carboxylate
Molecular Formula C13H12FNO4
Molecular Weight 265.24 g/mol
SMILES CCOC(=O)C1=CNC2=CC(=C(C=C2C1=O)OC)F
InChIKey FUJNUQDCBRIKRF-UHFFFAOYSA-N
Last Updated: 2026-04-01 14:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 7-fluoro-4-hydroxy-6-methoxyquinoline-3-carboxylate (CAS: 622369-35-1)?

Ethyl 7-fluoro-4-hydroxy-6-methoxyquinoline-3-carboxylate (CAS: 622369-35-1) is a crystalline compou...

Compound Q&A

How is Ethyl 7-fluoro-4-hydroxy-6-methoxyquinoline-3-carboxylate (CAS: 622369-35-1) typically synthesized?

Ethyl 7-fluoro-4-hydroxy-6-methoxyquinoline-3-carboxylate (CAS: 622369-35-1) is typically synthesize...

Compound Q&A

What industries use Ethyl 7-fluoro-4-hydroxy-6-methoxyquinoline-3-carboxylate (CAS: 622369-35-1)?

Ethyl 7-fluoro-4-hydroxy-6-methoxyquinoline-3-carboxylate (CAS: 622369-35-1) finds application in th...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...