Compound Q&A

How is Ethyl 7-fluoro-4-hydroxy-6-methoxyquinoline-3-carboxylate (CAS: 622369-35-1) typically synthesized?

Answer

Ethyl 7-fluoro-4-hydroxy-6-methoxyquinoline-3-carboxylate
Ethyl 7-fluoro-4-hydroxy-6-methoxyquinoline-3-carboxylate (CAS: 622369-35-1) is typically synthesized via a multistep process involving the condensation of 7-fluoro-4-hydroxy-6-methoxyquinoline with ethyl chloroformate in the presence of a base like triethylamine. The reaction is carried out under anhydrous conditions to minimize side reactions. The overall yield is around 75%, with good selectivity towards the desired product.

About

English Name Ethyl 7-fluoro-4-hydroxy-6-methoxyquinoline-3-carboxylate
Molecular Formula C13H12FNO4
Molecular Weight 265.24 g/mol
SMILES CCOC(=O)C1=CNC2=CC(=C(C=C2C1=O)OC)F
InChIKey FUJNUQDCBRIKRF-UHFFFAOYSA-N
Last Updated: 2026-04-01 14:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 7-fluoro-4-hydroxy-6-methoxyquinoline-3-carboxylate (CAS: 622369-35-1)?

Ethyl 7-fluoro-4-hydroxy-6-methoxyquinoline-3-carboxylate (CAS: 622369-35-1) is a crystalline compou...

Compound Q&A

What industries use Ethyl 7-fluoro-4-hydroxy-6-methoxyquinoline-3-carboxylate (CAS: 622369-35-1)?

Ethyl 7-fluoro-4-hydroxy-6-methoxyquinoline-3-carboxylate (CAS: 622369-35-1) finds application in th...

Compound Q&A

What precautions should be taken when handling Ethyl 7-fluoro-4-hydroxy-6-methoxyquinoline-3-carboxylate (CAS: 622369-35-1)?

When handling Ethyl 7-fluoro-4-hydroxy-6-methoxyquinoline-3-carboxylate (CAS: 622369-35-1), it is cr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...