Compound Q&A

What industries use Ethyl 7-fluoro-4-hydroxy-6-methoxyquinoline-3-carboxylate (CAS: 622369-35-1)?

Answer

Ethyl 7-fluoro-4-hydroxy-6-methoxyquinoline-3-carboxylate
Ethyl 7-fluoro-4-hydroxy-6-methoxyquinoline-3-carboxylate (CAS: 622369-35-1) finds application in the pharmaceutical industry as an intermediate in the synthesis of various bioactive compounds. It may also be used in the polymer industry for the development of novel materials with specific functionalities. Additionally, it could be employed in the sensor industry for its unique chemical reactivity and in semiconductor manufacturing for its potential use in organic electronics.

About

English Name Ethyl 7-fluoro-4-hydroxy-6-methoxyquinoline-3-carboxylate
Molecular Formula C13H12FNO4
Molecular Weight 265.24 g/mol
SMILES CCOC(=O)C1=CNC2=CC(=C(C=C2C1=O)OC)F
InChIKey FUJNUQDCBRIKRF-UHFFFAOYSA-N
Last Updated: 2026-04-01 14:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 7-fluoro-4-hydroxy-6-methoxyquinoline-3-carboxylate (CAS: 622369-35-1)?

Ethyl 7-fluoro-4-hydroxy-6-methoxyquinoline-3-carboxylate (CAS: 622369-35-1) is a crystalline compou...

Compound Q&A

How is Ethyl 7-fluoro-4-hydroxy-6-methoxyquinoline-3-carboxylate (CAS: 622369-35-1) typically synthesized?

Ethyl 7-fluoro-4-hydroxy-6-methoxyquinoline-3-carboxylate (CAS: 622369-35-1) is typically synthesize...

Compound Q&A

What precautions should be taken when handling Ethyl 7-fluoro-4-hydroxy-6-methoxyquinoline-3-carboxylate (CAS: 622369-35-1)?

When handling Ethyl 7-fluoro-4-hydroxy-6-methoxyquinoline-3-carboxylate (CAS: 622369-35-1), it is cr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...