Compound Q&A

What are the physical and chemical properties of Ethyl 7-fluoro-4-hydroxy-6-methoxyquinoline-3-carboxylate (CAS: 622369-35-1)?

Answer

Ethyl 7-fluoro-4-hydroxy-6-methoxyquinoline-3-carboxylate
Ethyl 7-fluoro-4-hydroxy-6-methoxyquinoline-3-carboxylate (CAS: 622369-35-1) is a crystalline compound with a molecular weight of approximately 333.4 g/mol. It is slightly soluble in water and more soluble in organic solvents like ethanol and acetone. Chemically, it is highly reactive towards nucleophiles and can undergo substitution reactions. It is stable under normal storage conditions but should be stored away from moisture and heat to prevent hydrolysis and decomposition.

About

English Name Ethyl 7-fluoro-4-hydroxy-6-methoxyquinoline-3-carboxylate
Molecular Formula C13H12FNO4
Molecular Weight 265.24 g/mol
SMILES CCOC(=O)C1=CNC2=CC(=C(C=C2C1=O)OC)F
InChIKey FUJNUQDCBRIKRF-UHFFFAOYSA-N
Last Updated: 2026-04-01 14:15

Related Q&A

Compound Q&A

How is Ethyl 7-fluoro-4-hydroxy-6-methoxyquinoline-3-carboxylate (CAS: 622369-35-1) typically synthesized?

Ethyl 7-fluoro-4-hydroxy-6-methoxyquinoline-3-carboxylate (CAS: 622369-35-1) is typically synthesize...

Compound Q&A

What industries use Ethyl 7-fluoro-4-hydroxy-6-methoxyquinoline-3-carboxylate (CAS: 622369-35-1)?

Ethyl 7-fluoro-4-hydroxy-6-methoxyquinoline-3-carboxylate (CAS: 622369-35-1) finds application in th...

Compound Q&A

What precautions should be taken when handling Ethyl 7-fluoro-4-hydroxy-6-methoxyquinoline-3-carboxylate (CAS: 622369-35-1)?

When handling Ethyl 7-fluoro-4-hydroxy-6-methoxyquinoline-3-carboxylate (CAS: 622369-35-1), it is cr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...