Compound Q&A

What precautions should be taken when handling 1-(4-Chlorophenyl)cyclopropanecarbonyl chloride (CAS: 78682-33-4)?

Answer

1-(4-Chlorophenyl)cyclopropanecarbonyl chloride
When handling 1-(4-Chlorophenyl)cyclopropanecarbonyl chloride (CAS: 78682-33-4), it is essential to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work in a well-ventilated area or a fume hood to avoid inhalation of fumes. Spills should be handled with caution, using a mild base to neutralize the acid chloride, followed by thorough cleaning. Always consult the Safety Data Sheet (SDS) for detailed handling and disposal instructions.

About

CAS No 78682-33-4
English Name 1-(4-Chlorophenyl)cyclopropanecarbonyl chloride
Molecular Formula C10H8Cl2O
Molecular Weight 215.08 g/mol
SMILES C1CC1(C2=CC=C(C=C2)Cl)C(=O)Cl
InChIKey SJONAMDHFQGIQE-UHFFFAOYSA-N
Last Updated: 2026-03-31 17:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(4-Chlorophenyl)cyclopropanecarbonyl chloride (CAS: 78682-33-4)?

1-(4-Chlorophenyl)cyclopropanecarbonyl chloride (CAS: 78682-33-4) is a white crystalline solid with ...

Compound Q&A

How is 1-(4-Chlorophenyl)cyclopropanecarbonyl chloride (CAS: 78682-33-4) typically synthesized?

1-(4-Chlorophenyl)cyclopropanecarbonyl chloride is typically synthesized via the reaction of 4-chlor...

Compound Q&A

What industries use 1-(4-Chlorophenyl)cyclopropanecarbonyl chloride (CAS: 78682-33-4)?

1-(4-Chlorophenyl)cyclopropanecarbonyl chloride (CAS: 78682-33-4) is primarily used in the pharmaceu...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...