Compound Q&A

What industries use 1-(4-Chlorophenyl)cyclopropanecarbonyl chloride (CAS: 78682-33-4)?

Answer

1-(4-Chlorophenyl)cyclopropanecarbonyl chloride
1-(4-Chlorophenyl)cyclopropanecarbonyl chloride (CAS: 78682-33-4) is primarily used in the pharmaceutical industry for the synthesis of various medicinal compounds. It is also employed in the production of certain polymers and as an intermediate in the development of new materials. Its use in sensors and semiconductors, although less common, is also reported.

About

CAS No 78682-33-4
English Name 1-(4-Chlorophenyl)cyclopropanecarbonyl chloride
Molecular Formula C10H8Cl2O
Molecular Weight 215.08 g/mol
SMILES C1CC1(C2=CC=C(C=C2)Cl)C(=O)Cl
InChIKey SJONAMDHFQGIQE-UHFFFAOYSA-N
Last Updated: 2026-03-31 17:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(4-Chlorophenyl)cyclopropanecarbonyl chloride (CAS: 78682-33-4)?

1-(4-Chlorophenyl)cyclopropanecarbonyl chloride (CAS: 78682-33-4) is a white crystalline solid with ...

Compound Q&A

How is 1-(4-Chlorophenyl)cyclopropanecarbonyl chloride (CAS: 78682-33-4) typically synthesized?

1-(4-Chlorophenyl)cyclopropanecarbonyl chloride is typically synthesized via the reaction of 4-chlor...

Compound Q&A

What precautions should be taken when handling 1-(4-Chlorophenyl)cyclopropanecarbonyl chloride (CAS: 78682-33-4)?

When handling 1-(4-Chlorophenyl)cyclopropanecarbonyl chloride (CAS: 78682-33-4), it is essential to ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...