Compound Q&A

What are the physical and chemical properties of 1-(4-Chlorophenyl)cyclopropanecarbonyl chloride (CAS: 78682-33-4)?

Answer

1-(4-Chlorophenyl)cyclopropanecarbonyl chloride
1-(4-Chlorophenyl)cyclopropanecarbonyl chloride (CAS: 78682-33-4) is a white crystalline solid with a molecular weight of approximately 229.63 g/mol. It has a low solubility in water but is soluble in organic solvents such as ethanol and chloroform. The compound is highly reactive, particularly with amines and nucleophiles, and is known for its potent electrophilic character.

About

CAS No 78682-33-4
English Name 1-(4-Chlorophenyl)cyclopropanecarbonyl chloride
Molecular Formula C10H8Cl2O
Molecular Weight 215.08 g/mol
SMILES C1CC1(C2=CC=C(C=C2)Cl)C(=O)Cl
InChIKey SJONAMDHFQGIQE-UHFFFAOYSA-N
Last Updated: 2026-03-31 17:51

Related Q&A

Compound Q&A

How is 1-(4-Chlorophenyl)cyclopropanecarbonyl chloride (CAS: 78682-33-4) typically synthesized?

1-(4-Chlorophenyl)cyclopropanecarbonyl chloride is typically synthesized via the reaction of 4-chlor...

Compound Q&A

What industries use 1-(4-Chlorophenyl)cyclopropanecarbonyl chloride (CAS: 78682-33-4)?

1-(4-Chlorophenyl)cyclopropanecarbonyl chloride (CAS: 78682-33-4) is primarily used in the pharmaceu...

Compound Q&A

What precautions should be taken when handling 1-(4-Chlorophenyl)cyclopropanecarbonyl chloride (CAS: 78682-33-4)?

When handling 1-(4-Chlorophenyl)cyclopropanecarbonyl chloride (CAS: 78682-33-4), it is essential to ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...