Compound Q&A

What industries use Bleomycin A5 (CAS: 11116-32-8)?

Answer

Bleomycin A5
Bleomycin A5 (CAS: 11116-32-8) is primarily used in the pharmaceutical industry for its antitumor properties. It is also explored in biotechnology for gene delivery and in medical research for cancer treatment studies.

About

CAS No 11116-32-8
English Name Bleomycin A5
Molecular Formula C57H89N19O21S2
Molecular Weight 1440.6 g/mol
SMILES CC1=C(N=C(N=C1N)C(CC(=O)N)NCC(C(=O)N)N)C(=O)NC(C(C2=CN=CN2)OC3C(C(C(C(O3)CO)O)O)OC4C(C(C(C(O4)CO)O)OC(=O)N)O)C(=O)NC(C)C(C(C)C(=O)NC(C(C)O)C(=O)NCCC5=NC(=CS5)C6=NC(=CS6)C(=O)NCCCNCCCCN)O
InChIKey QYOAUOAXCQAEMW-UTXKDXHTSA-N
Last Updated: 2026-03-29 08:05

Related Q&A

Compound Q&A

What are the physical and chemical properties of Bleomycin A5 (CAS: 11116-32-8)?

Bleomycin A5 (CAS: 11116-32-8) is a cyclic polyketide antibiotic with a molecular weight of approxim...

Compound Q&A

How is Bleomycin A5 (CAS: 11116-32-8) typically synthesized?

Bleomycin A5 (CAS: 11116-32-8) is synthesized through multi-step chemical reactions starting from di...

Compound Q&A

What precautions should be taken when handling Bleomycin A5 (CAS: 11116-32-8)?

When handling Bleomycin A5 (CAS: 11116-32-8), it is essential to use personal protective equipment (...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...