Compound Q&A

What are the physical and chemical properties of Bleomycin A5 (CAS: 11116-32-8)?

Answer

Bleomycin A5
Bleomycin A5 (CAS: 11116-32-8) is a cyclic polyketide antibiotic with a molecular weight of approximately 1924 g/mol. It is insoluble in water but soluble in organic solvents like ethanol and dimethyl sulfoxide. Chemically, it exhibits oxidative reactivity and is known for its antitumor activity.

About

CAS No 11116-32-8
English Name Bleomycin A5
Molecular Formula C57H89N19O21S2
Molecular Weight 1440.6 g/mol
SMILES CC1=C(N=C(N=C1N)C(CC(=O)N)NCC(C(=O)N)N)C(=O)NC(C(C2=CN=CN2)OC3C(C(C(C(O3)CO)O)O)OC4C(C(C(C(O4)CO)O)OC(=O)N)O)C(=O)NC(C)C(C(C)C(=O)NC(C(C)O)C(=O)NCCC5=NC(=CS5)C6=NC(=CS6)C(=O)NCCCNCCCCN)O
InChIKey QYOAUOAXCQAEMW-UTXKDXHTSA-N
Last Updated: 2026-03-29 08:05

Related Q&A

Compound Q&A

How is Bleomycin A5 (CAS: 11116-32-8) typically synthesized?

Bleomycin A5 (CAS: 11116-32-8) is synthesized through multi-step chemical reactions starting from di...

Compound Q&A

What industries use Bleomycin A5 (CAS: 11116-32-8)?

Bleomycin A5 (CAS: 11116-32-8) is primarily used in the pharmaceutical industry for its antitumor pr...

Compound Q&A

What precautions should be taken when handling Bleomycin A5 (CAS: 11116-32-8)?

When handling Bleomycin A5 (CAS: 11116-32-8), it is essential to use personal protective equipment (...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...