Compound Q&A

What industries use 1-(4-Nitrophenyl)-4-piperidinecarboxylic acid (CAS: 223786-53-6)?

Answer

1-(4-Nitrophenyl)-4-piperidinecarboxylic acid
1-(4-Nitrophenyl)-4-piperidinecarboxylic acid (CAS: 223786-53-6) is primarily used in pharmaceuticals for the synthesis of various medicinals and also in the polymer industry for developing new materials. Additionally, it has applications in the semiconductor industry for use in sensors and electronic components.

About

English Name 1-(4-Nitrophenyl)-4-piperidinecarboxylic acid
Molecular Formula C12H14N2O4
Molecular Weight 250.25 g/mol
SMILES OC(=O)C1CCN(CC1)c1ccc(cc1)[N+](=O)[O-]
InChIKey ZIRBMAVPCZUDTF-UHFFFAOYSA-N
Last Updated: 2026-03-23 08:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(4-Nitrophenyl)-4-piperidinecarboxylic acid (CAS: 223786-53-6)?

1-(4-Nitrophenyl)-4-piperidinecarboxylic acid (CAS: 223786-53-6) is a white crystalline solid with a...

Compound Q&A

How is 1-(4-Nitrophenyl)-4-piperidinecarboxylic acid (CAS: 223786-53-6) typically synthesized?

1-(4-Nitrophenyl)-4-piperidinecarboxylic acid is typically synthesized via the condensation of 4-nit...

Compound Q&A

What precautions should be taken when handling 1-(4-Nitrophenyl)-4-piperidinecarboxylic acid (CAS: 223786-53-6)?

When handling 1-(4-Nitrophenyl)-4-piperidinecarboxylic acid (CAS: 223786-53-6), it is crucial to wea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...