Compound Q&A

What are the physical and chemical properties of 1-(4-Nitrophenyl)-4-piperidinecarboxylic acid (CAS: 223786-53-6)?

Answer

1-(4-Nitrophenyl)-4-piperidinecarboxylic acid
1-(4-Nitrophenyl)-4-piperidinecarboxylic acid (CAS: 223786-53-6) is a white crystalline solid with a molecular weight of approximately 286.14 g/mol. It is slightly soluble in water and ethanol. The compound is reactive towards nucleophiles and can undergo substitution reactions. It is also known for its high melting point and good stability under normal conditions.

About

English Name 1-(4-Nitrophenyl)-4-piperidinecarboxylic acid
Molecular Formula C12H14N2O4
Molecular Weight 250.25 g/mol
SMILES OC(=O)C1CCN(CC1)c1ccc(cc1)[N+](=O)[O-]
InChIKey ZIRBMAVPCZUDTF-UHFFFAOYSA-N
Last Updated: 2026-03-23 08:16

Related Q&A

Compound Q&A

How is 1-(4-Nitrophenyl)-4-piperidinecarboxylic acid (CAS: 223786-53-6) typically synthesized?

1-(4-Nitrophenyl)-4-piperidinecarboxylic acid is typically synthesized via the condensation of 4-nit...

Compound Q&A

What industries use 1-(4-Nitrophenyl)-4-piperidinecarboxylic acid (CAS: 223786-53-6)?

1-(4-Nitrophenyl)-4-piperidinecarboxylic acid (CAS: 223786-53-6) is primarily used in pharmaceutical...

Compound Q&A

What precautions should be taken when handling 1-(4-Nitrophenyl)-4-piperidinecarboxylic acid (CAS: 223786-53-6)?

When handling 1-(4-Nitrophenyl)-4-piperidinecarboxylic acid (CAS: 223786-53-6), it is crucial to wea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...