Compound Q&A

How is 1-(4-Nitrophenyl)-4-piperidinecarboxylic acid (CAS: 223786-53-6) typically synthesized?

Answer

1-(4-Nitrophenyl)-4-piperidinecarboxylic acid
1-(4-Nitrophenyl)-4-piperidinecarboxylic acid is typically synthesized via the condensation of 4-nitrophenyl chloroformate with piperidine. The reaction is carried out under anhydrous conditions, with triethylamine as a base and dichloromethane as the solvent. This method provides good selectivity and yield, making it a common approach in the chemical industry.

About

English Name 1-(4-Nitrophenyl)-4-piperidinecarboxylic acid
Molecular Formula C12H14N2O4
Molecular Weight 250.25 g/mol
SMILES OC(=O)C1CCN(CC1)c1ccc(cc1)[N+](=O)[O-]
InChIKey ZIRBMAVPCZUDTF-UHFFFAOYSA-N
Last Updated: 2026-03-23 08:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(4-Nitrophenyl)-4-piperidinecarboxylic acid (CAS: 223786-53-6)?

1-(4-Nitrophenyl)-4-piperidinecarboxylic acid (CAS: 223786-53-6) is a white crystalline solid with a...

Compound Q&A

What industries use 1-(4-Nitrophenyl)-4-piperidinecarboxylic acid (CAS: 223786-53-6)?

1-(4-Nitrophenyl)-4-piperidinecarboxylic acid (CAS: 223786-53-6) is primarily used in pharmaceutical...

Compound Q&A

What precautions should be taken when handling 1-(4-Nitrophenyl)-4-piperidinecarboxylic acid (CAS: 223786-53-6)?

When handling 1-(4-Nitrophenyl)-4-piperidinecarboxylic acid (CAS: 223786-53-6), it is crucial to wea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...