Compound Q&A

What industries use Levocetirizine amide (CAS: 909779-33-5)?

Answer

Levocetirizine amide
Levocetirizine amide (CAS: 909779-33-5) is primarily used in the pharmaceutical industry for manufacturing antihistamine drugs. It is also applied in the chemical industry for its reactivity in various organic reactions. Additionally, it can be utilized in polymer and sensor applications due to its chemical properties.

About

English Name Levocetirizine amide
Molecular Formula C21H26ClN3O2
Molecular Weight 387.91 g/mol
SMILES C1CN(CCN1CCOCC(=O)N)C(C2=CC=CC=C2)C3=CC=C(C=C3)Cl
InChIKey LVJDQBJDVOYDLA-OAQYLSRUSA-N
Last Updated: 2026-03-23 00:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of Levocetirizine amide (CAS: 909779-33-5)?

Levocetirizine amide (CAS: 909779-33-5) is a white to off-white crystalline powder. Its molecular we...

Compound Q&A

How is Levocetirizine amide (CAS: 909779-33-5) typically synthesized?

Levocetirizine amide (CAS: 909779-33-5) is synthesized via amidation of levocetirizine with a suitab...

Compound Q&A

What precautions should be taken when handling Levocetirizine amide (CAS: 909779-33-5)?

When handling Levocetirizine amide (CAS: 909779-33-5), wear appropriate personal protective equipmen...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...