Compound Q&A

How is Levocetirizine amide (CAS: 909779-33-5) typically synthesized?

Answer

Levocetirizine amide
Levocetirizine amide (CAS: 909779-33-5) is synthesized via amidation of levocetirizine with a suitable amine. The reaction is typically catalyzed by a coupling agent like HATU and is carried out in a polar aprotic solvent such as N,N-Dimethylformamide (DMF). The process is selective, with high yield and good purity.

About

English Name Levocetirizine amide
Molecular Formula C21H26ClN3O2
Molecular Weight 387.91 g/mol
SMILES C1CN(CCN1CCOCC(=O)N)C(C2=CC=CC=C2)C3=CC=C(C=C3)Cl
InChIKey LVJDQBJDVOYDLA-OAQYLSRUSA-N
Last Updated: 2026-03-23 00:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of Levocetirizine amide (CAS: 909779-33-5)?

Levocetirizine amide (CAS: 909779-33-5) is a white to off-white crystalline powder. Its molecular we...

Compound Q&A

What industries use Levocetirizine amide (CAS: 909779-33-5)?

Levocetirizine amide (CAS: 909779-33-5) is primarily used in the pharmaceutical industry for manufac...

Compound Q&A

What precautions should be taken when handling Levocetirizine amide (CAS: 909779-33-5)?

When handling Levocetirizine amide (CAS: 909779-33-5), wear appropriate personal protective equipmen...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...