Compound Q&A

What are the physical and chemical properties of Levocetirizine amide (CAS: 909779-33-5)?

Answer

Levocetirizine amide
Levocetirizine amide (CAS: 909779-33-5) is a white to off-white crystalline powder. Its molecular weight is approximately 271.27 g/mol. It has a low solubility in water but is more soluble in organic solvents. Chemically, it is moderately reactive towards bases and is stable in acidic conditions. It undergoes hydrolysis under basic conditions and can react with nucleophiles.

About

English Name Levocetirizine amide
Molecular Formula C21H26ClN3O2
Molecular Weight 387.91 g/mol
SMILES C1CN(CCN1CCOCC(=O)N)C(C2=CC=CC=C2)C3=CC=C(C=C3)Cl
InChIKey LVJDQBJDVOYDLA-OAQYLSRUSA-N
Last Updated: 2026-03-23 00:14

Related Q&A

Compound Q&A

How is Levocetirizine amide (CAS: 909779-33-5) typically synthesized?

Levocetirizine amide (CAS: 909779-33-5) is synthesized via amidation of levocetirizine with a suitab...

Compound Q&A

What industries use Levocetirizine amide (CAS: 909779-33-5)?

Levocetirizine amide (CAS: 909779-33-5) is primarily used in the pharmaceutical industry for manufac...

Compound Q&A

What precautions should be taken when handling Levocetirizine amide (CAS: 909779-33-5)?

When handling Levocetirizine amide (CAS: 909779-33-5), wear appropriate personal protective equipmen...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...