Compound Q&A

What industries use 5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7)?

Answer

5-(Chlorosulfonyl)-2-methylbenzoyl chloride
5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7) is primarily used in the pharmaceutical industry for the synthesis of intermediates and active pharmaceutical ingredients. It also finds applications in the polymer industry for the preparation of functional polymers, and in the semiconductor industry for microelectronics manufacturing, where it serves as a precursor for various functional groups.

About

English Name 5-(Chlorosulfonyl)-2-methylbenzoyl chloride
Molecular Formula C8H6Cl2O3S
Molecular Weight 253.106 g/mol
SMILES Cc1ccc(cc1C(=O)Cl)S(=O)(=O)Cl
InChIKey LIANSSSABWUTRH-UHFFFAOYSA-N
Last Updated: 2026-03-17 06:03

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7)?

5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7) is a crystalline solid with a molecu...

Compound Q&A

How is 5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7) typically synthesized?

5-(Chlorosulfonyl)-2-methylbenzoyl chloride is typically synthesized through the chlorosulfonylation...

Compound Q&A

What precautions should be taken when handling 5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7)?

When handling 5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7), it is crucial to wear...

Compound Q&A

What are the physical and chemical properties of Disodium 2-hydroxypentanedioate (CAS: 40951-21-1)?

Disodium 2-hydroxypentanedioate is a white crystalline solid with a molecular we...

40951-21-1Disodium 2-hydroxype...
Compound Q&A

What industries use 5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7)?

5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7) is primarily use...

1426437-45-75-(Chlorosulfonyl)-2...
Compound Q&A

How should (2R)-2-[(Tert-butoxy)carbonylamino]-2-(2-naphthyl)acetic acid (CAS: 93779-36-3) be stored?

(2R)-2-[(Tert-butoxy)carbonylamino]-2-(2-naphthyl)acetic acid (CAS: 93779-36-3) ...

93779-36-3(2R)-2-[(Tert-butoxy...
Compound Q&A

What industries use Methyl 6-bromo-2-pyridinecarboxylate (CAS: 26218-75-7)?

Methyl 6-bromo-2-pyridinecarboxylate (CAS: 26218-75-7) is primarily used in the ...

26218-75-7Methyl 6-bromo-2-pyr...