Compound Q&A

What precautions should be taken when handling 5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7)?

Answer

5-(Chlorosulfonyl)-2-methylbenzoyl chloride
When handling 5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7), it is crucial to wear appropriate personal protective equipment (PPE), including gloves, goggles, and a lab coat. The compound should be used in a well-ventilated area or a fume hood to avoid inhalation. Spills should be cleaned up immediately with caution, using appropriate absorbents, and proper disposal methods should be followed. Always consult the safety data sheet (SDS) for detailed handling and emergency procedures.

About

English Name 5-(Chlorosulfonyl)-2-methylbenzoyl chloride
Molecular Formula C8H6Cl2O3S
Molecular Weight 253.106 g/mol
SMILES Cc1ccc(cc1C(=O)Cl)S(=O)(=O)Cl
InChIKey LIANSSSABWUTRH-UHFFFAOYSA-N
Last Updated: 2026-03-17 06:03

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7)?

5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7) is a crystalline solid with a molecu...

Compound Q&A

How is 5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7) typically synthesized?

5-(Chlorosulfonyl)-2-methylbenzoyl chloride is typically synthesized through the chlorosulfonylation...

Compound Q&A

What industries use 5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7)?

5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7) is primarily used in the pharmaceuti...

Compound Q&A

What are the physical and chemical properties of Disodium 2-hydroxypentanedioate (CAS: 40951-21-1)?

Disodium 2-hydroxypentanedioate is a white crystalline solid with a molecular we...

40951-21-1Disodium 2-hydroxype...
Compound Q&A

What industries use 5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7)?

5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7) is primarily use...

1426437-45-75-(Chlorosulfonyl)-2...
Compound Q&A

How should (2R)-2-[(Tert-butoxy)carbonylamino]-2-(2-naphthyl)acetic acid (CAS: 93779-36-3) be stored?

(2R)-2-[(Tert-butoxy)carbonylamino]-2-(2-naphthyl)acetic acid (CAS: 93779-36-3) ...

93779-36-3(2R)-2-[(Tert-butoxy...
Compound Q&A

What industries use Methyl 6-bromo-2-pyridinecarboxylate (CAS: 26218-75-7)?

Methyl 6-bromo-2-pyridinecarboxylate (CAS: 26218-75-7) is primarily used in the ...

26218-75-7Methyl 6-bromo-2-pyr...