Compound Q&A

What are the physical and chemical properties of 5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7)?

Answer

5-(Chlorosulfonyl)-2-methylbenzoyl chloride
5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7) is a crystalline solid with a molecular weight of approximately 299.6 g/mol. It is poorly water-soluble but soluble in common organic solvents such as dichloromethane and acetonitrile. This compound is highly reactive, particularly toward nucleophiles, and is known to be sensitive to moisture and heat, which can lead to decomposition.

About

English Name 5-(Chlorosulfonyl)-2-methylbenzoyl chloride
Molecular Formula C8H6Cl2O3S
Molecular Weight 253.106 g/mol
SMILES Cc1ccc(cc1C(=O)Cl)S(=O)(=O)Cl
InChIKey LIANSSSABWUTRH-UHFFFAOYSA-N
Last Updated: 2026-03-17 06:03

Related Q&A

Compound Q&A

How is 5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7) typically synthesized?

5-(Chlorosulfonyl)-2-methylbenzoyl chloride is typically synthesized through the chlorosulfonylation...

Compound Q&A

What industries use 5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7)?

5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7) is primarily used in the pharmaceuti...

Compound Q&A

What precautions should be taken when handling 5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7)?

When handling 5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7), it is crucial to wear...

Compound Q&A

What are the physical and chemical properties of Disodium 2-hydroxypentanedioate (CAS: 40951-21-1)?

Disodium 2-hydroxypentanedioate is a white crystalline solid with a molecular we...

40951-21-1Disodium 2-hydroxype...
Compound Q&A

What industries use 5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7)?

5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7) is primarily use...

1426437-45-75-(Chlorosulfonyl)-2...
Compound Q&A

How should (2R)-2-[(Tert-butoxy)carbonylamino]-2-(2-naphthyl)acetic acid (CAS: 93779-36-3) be stored?

(2R)-2-[(Tert-butoxy)carbonylamino]-2-(2-naphthyl)acetic acid (CAS: 93779-36-3) ...

93779-36-3(2R)-2-[(Tert-butoxy...
Compound Q&A

What industries use Methyl 6-bromo-2-pyridinecarboxylate (CAS: 26218-75-7)?

Methyl 6-bromo-2-pyridinecarboxylate (CAS: 26218-75-7) is primarily used in the ...

26218-75-7Methyl 6-bromo-2-pyr...