Compound Q&A

How is 5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7) typically synthesized?

Answer

5-(Chlorosulfonyl)-2-methylbenzoyl chloride
5-(Chlorosulfonyl)-2-methylbenzoyl chloride is typically synthesized through the chlorosulfonylation of 2-methylbenzoic acid. The reaction is catalyzed by thionyl chloride in the presence of a suitable solvent like chloroform. High yields and selectivity can be achieved under mild conditions, making this a fairly straightforward process in organic synthesis.

About

English Name 5-(Chlorosulfonyl)-2-methylbenzoyl chloride
Molecular Formula C8H6Cl2O3S
Molecular Weight 253.106 g/mol
SMILES Cc1ccc(cc1C(=O)Cl)S(=O)(=O)Cl
InChIKey LIANSSSABWUTRH-UHFFFAOYSA-N
Last Updated: 2026-03-17 06:03

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7)?

5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7) is a crystalline solid with a molecu...

Compound Q&A

What industries use 5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7)?

5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7) is primarily used in the pharmaceuti...

Compound Q&A

What precautions should be taken when handling 5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7)?

When handling 5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7), it is crucial to wear...

Compound Q&A

What are the physical and chemical properties of Disodium 2-hydroxypentanedioate (CAS: 40951-21-1)?

Disodium 2-hydroxypentanedioate is a white crystalline solid with a molecular we...

40951-21-1Disodium 2-hydroxype...
Compound Q&A

What industries use 5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7)?

5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7) is primarily use...

1426437-45-75-(Chlorosulfonyl)-2...
Compound Q&A

How should (2R)-2-[(Tert-butoxy)carbonylamino]-2-(2-naphthyl)acetic acid (CAS: 93779-36-3) be stored?

(2R)-2-[(Tert-butoxy)carbonylamino]-2-(2-naphthyl)acetic acid (CAS: 93779-36-3) ...

93779-36-3(2R)-2-[(Tert-butoxy...
Compound Q&A

What industries use Methyl 6-bromo-2-pyridinecarboxylate (CAS: 26218-75-7)?

Methyl 6-bromo-2-pyridinecarboxylate (CAS: 26218-75-7) is primarily used in the ...

26218-75-7Methyl 6-bromo-2-pyr...