Compound Q&A

What industries use 4-[(4-Bromobenzyl)oxy]quinazoline (CAS: 737818-56-3)?

Answer

4-[(4-Bromobenzyl)oxy]quinazoline
4-[(4-Bromobenzyl)oxy]quinazoline (CAS: 737818-56-3) is used in a variety of industries, including pharmaceuticals, where it serves as a potential intermediate in drug synthesis. It also finds applications in the development of sensors and semiconductors due to its unique chemical properties. The compound's ability to participate in specific reactions makes it valuable in the research and development of new materials and pharmaceuticals.

About

English Name 4-[(4-Bromobenzyl)oxy]quinazoline
Molecular Formula C15H11BrN2O
Molecular Weight 315.17 g/mol
SMILES c1ccc2c(c1)c(ncn2)OCc3ccc(cc3)Br
InChIKey DADJIQURPZZXBT-UHFFFAOYSA-N
Last Updated: 2026-03-17 01:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-[(4-Bromobenzyl)oxy]quinazoline (CAS: 737818-56-3)?

4-[(4-Bromobenzyl)oxy]quinazoline (CAS: 737818-56-3) is a crystalline solid with a molecular weight ...

Compound Q&A

How is 4-[(4-Bromobenzyl)oxy]quinazoline (CAS: 737818-56-3) typically synthesized?

4-[(4-Bromobenzyl)oxy]quinazoline (CAS: 737818-56-3) is typically synthesized via a multi-step proce...

Compound Q&A

What precautions should be taken when handling 4-[(4-Bromobenzyl)oxy]quinazoline (CAS: 737818-56-3)?

When handling 4-[(4-Bromobenzyl)oxy]quinazoline (CAS: 737818-56-3), it is essential to wear appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...