Compound Q&A

What are the physical and chemical properties of 4-[(4-Bromobenzyl)oxy]quinazoline (CAS: 737818-56-3)?

Answer

4-[(4-Bromobenzyl)oxy]quinazoline
4-[(4-Bromobenzyl)oxy]quinazoline (CAS: 737818-56-3) is a crystalline solid with a molecular weight of approximately 354.05 g/mol. It has a melting point of around 210-212°C and is poorly soluble in water but soluble in organic solvents like dichloromethane and methanol. Chemically, it is less reactive towards common acids and bases but can undergo nucleophilic substitution reactions. It is stable under normal laboratory conditions but should be stored in a cool, dry place away from direct sunlight.

About

English Name 4-[(4-Bromobenzyl)oxy]quinazoline
Molecular Formula C15H11BrN2O
Molecular Weight 315.17 g/mol
SMILES c1ccc2c(c1)c(ncn2)OCc3ccc(cc3)Br
InChIKey DADJIQURPZZXBT-UHFFFAOYSA-N
Last Updated: 2026-03-17 01:51

Related Q&A

Compound Q&A

How is 4-[(4-Bromobenzyl)oxy]quinazoline (CAS: 737818-56-3) typically synthesized?

4-[(4-Bromobenzyl)oxy]quinazoline (CAS: 737818-56-3) is typically synthesized via a multi-step proce...

Compound Q&A

What industries use 4-[(4-Bromobenzyl)oxy]quinazoline (CAS: 737818-56-3)?

4-[(4-Bromobenzyl)oxy]quinazoline (CAS: 737818-56-3) is used in a variety of industries, including p...

Compound Q&A

What precautions should be taken when handling 4-[(4-Bromobenzyl)oxy]quinazoline (CAS: 737818-56-3)?

When handling 4-[(4-Bromobenzyl)oxy]quinazoline (CAS: 737818-56-3), it is essential to wear appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...