Compound Q&A

How is 4-[(4-Bromobenzyl)oxy]quinazoline (CAS: 737818-56-3) typically synthesized?

Answer

4-[(4-Bromobenzyl)oxy]quinazoline
4-[(4-Bromobenzyl)oxy]quinazoline (CAS: 737818-56-3) is typically synthesized via a multi-step process involving the reaction of quinazoline with 4-bromobenzyl alcohol. The synthesis involves protecting the amine group, followed by a coupling reaction and deprotection. The overall reaction yields approximately 60-70% of the target compound, and the process is conducted under mild conditions using catalytic amounts of a suitable reagent. Proper workup and purification techniques are necessary to isolate the final product.

About

English Name 4-[(4-Bromobenzyl)oxy]quinazoline
Molecular Formula C15H11BrN2O
Molecular Weight 315.17 g/mol
SMILES c1ccc2c(c1)c(ncn2)OCc3ccc(cc3)Br
InChIKey DADJIQURPZZXBT-UHFFFAOYSA-N
Last Updated: 2026-03-17 01:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-[(4-Bromobenzyl)oxy]quinazoline (CAS: 737818-56-3)?

4-[(4-Bromobenzyl)oxy]quinazoline (CAS: 737818-56-3) is a crystalline solid with a molecular weight ...

Compound Q&A

What industries use 4-[(4-Bromobenzyl)oxy]quinazoline (CAS: 737818-56-3)?

4-[(4-Bromobenzyl)oxy]quinazoline (CAS: 737818-56-3) is used in a variety of industries, including p...

Compound Q&A

What precautions should be taken when handling 4-[(4-Bromobenzyl)oxy]quinazoline (CAS: 737818-56-3)?

When handling 4-[(4-Bromobenzyl)oxy]quinazoline (CAS: 737818-56-3), it is essential to wear appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...