Compound Q&A

What precautions should be taken when handling tert-butyl 4-hydroxy-3-MethoxybenzylcarbaMate (CAS: 130972-89-3)?

Answer

tert-butyl 4-hydroxy-3-MethoxybenzylcarbaMate
When handling tert-butyl 4-hydroxy-3-MethoxybenzylcarbaMate (CAS: 130972-89-3), it is essential to wear appropriate personal protective equipment (PPE), including gloves and safety goggles. Work should be conducted in a well-ventilated area or a fume hood to minimize exposure to the compound. Spills should be cleaned up immediately using appropriate neutralizing agents and rinsing with copious amounts of water. Always refer to the Safety Data Sheet (SDS) for detailed handling and emergency procedures.

About

English Name tert-butyl 4-hydroxy-3-MethoxybenzylcarbaMate
Molecular Formula C13H19NO4
Molecular Weight 253.3 g/mol
SMILES CC(C)(C)OC(=O)NCC1=CC(=C(C=C1)O)OC
InChIKey SAFGFWHMYJRFPH-UHFFFAOYSA-N
Last Updated: 2026-03-16 17:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of tert-butyl 4-hydroxy-3-MethoxybenzylcarbaMate (CAS: 130972-89-3)?

Tert-butyl 4-hydroxy-3-MethoxybenzylcarbaMate (CAS: 130972-89-3) is a white crystalline solid with a...

Compound Q&A

How is tert-butyl 4-hydroxy-3-MethoxybenzylcarbaMate (CAS: 130972-89-3) typically synthesized?

Tert-butyl 4-hydroxy-3-MethoxybenzylcarbaMate is commonly synthesized through a multi-step process i...

Compound Q&A

What industries use tert-butyl 4-hydroxy-3-MethoxybenzylcarbaMate (CAS: 130972-89-3)?

Tert-butyl 4-hydroxy-3-MethoxybenzylcarbaMate is used in various industries, particularly in pharmac...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...