Compound Q&A

What are the physical and chemical properties of tert-butyl 4-hydroxy-3-MethoxybenzylcarbaMate (CAS: 130972-89-3)?

Answer

tert-butyl 4-hydroxy-3-MethoxybenzylcarbaMate
Tert-butyl 4-hydroxy-3-MethoxybenzylcarbaMate (CAS: 130972-89-3) is a white crystalline solid with a molecular weight of approximately 285.35 g/mol. It is slightly soluble in water and more soluble in organic solvents like methanol and ethanol. It is known for its high reactivity towards nucleophiles and bases due to its phenolic and methoxy groups.

About

English Name tert-butyl 4-hydroxy-3-MethoxybenzylcarbaMate
Molecular Formula C13H19NO4
Molecular Weight 253.3 g/mol
SMILES CC(C)(C)OC(=O)NCC1=CC(=C(C=C1)O)OC
InChIKey SAFGFWHMYJRFPH-UHFFFAOYSA-N
Last Updated: 2026-03-16 17:23

Related Q&A

Compound Q&A

How is tert-butyl 4-hydroxy-3-MethoxybenzylcarbaMate (CAS: 130972-89-3) typically synthesized?

Tert-butyl 4-hydroxy-3-MethoxybenzylcarbaMate is commonly synthesized through a multi-step process i...

Compound Q&A

What industries use tert-butyl 4-hydroxy-3-MethoxybenzylcarbaMate (CAS: 130972-89-3)?

Tert-butyl 4-hydroxy-3-MethoxybenzylcarbaMate is used in various industries, particularly in pharmac...

Compound Q&A

What precautions should be taken when handling tert-butyl 4-hydroxy-3-MethoxybenzylcarbaMate (CAS: 130972-89-3)?

When handling tert-butyl 4-hydroxy-3-MethoxybenzylcarbaMate (CAS: 130972-89-3), it is essential to w...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...