Compound Q&A

What industries use tert-butyl 4-hydroxy-3-MethoxybenzylcarbaMate (CAS: 130972-89-3)?

Answer

tert-butyl 4-hydroxy-3-MethoxybenzylcarbaMate
Tert-butyl 4-hydroxy-3-MethoxybenzylcarbaMate is used in various industries, particularly in pharmaceuticals for the synthesis of active pharmaceutical ingredients (APIs) and as a precursor in polymer chemistry for the development of functional polymers. It also has applications in the production of sensors and semiconductors due to its unique chemical properties.

About

English Name tert-butyl 4-hydroxy-3-MethoxybenzylcarbaMate
Molecular Formula C13H19NO4
Molecular Weight 253.3 g/mol
SMILES CC(C)(C)OC(=O)NCC1=CC(=C(C=C1)O)OC
InChIKey SAFGFWHMYJRFPH-UHFFFAOYSA-N
Last Updated: 2026-03-16 17:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of tert-butyl 4-hydroxy-3-MethoxybenzylcarbaMate (CAS: 130972-89-3)?

Tert-butyl 4-hydroxy-3-MethoxybenzylcarbaMate (CAS: 130972-89-3) is a white crystalline solid with a...

Compound Q&A

How is tert-butyl 4-hydroxy-3-MethoxybenzylcarbaMate (CAS: 130972-89-3) typically synthesized?

Tert-butyl 4-hydroxy-3-MethoxybenzylcarbaMate is commonly synthesized through a multi-step process i...

Compound Q&A

What precautions should be taken when handling tert-butyl 4-hydroxy-3-MethoxybenzylcarbaMate (CAS: 130972-89-3)?

When handling tert-butyl 4-hydroxy-3-MethoxybenzylcarbaMate (CAS: 130972-89-3), it is essential to w...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...